Cyclic GMP
PubChem CID: 135398570
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | cGMP, 7665-99-8, cyclic gmp, 3',5'-cyclic GMP, Cyclic guanosine monophosphate, Guanosine 3',5'-cyclic monophosphate, Guanosine 3',5'-monophosphate, Guanosine cyclic monophosphate, guanosine 3',5'-cyclic phosphate, cyclic-GMP, Cyclic 3',5'-GMP, CHEBI:16356, UNII-H2D2X058MU, Cyclic 3',5'-guanylic acid, H2D2X058MU, Guanosine cyclic 3',5'-phosphate, C-GMP, EINECS 231-641-6, 3',5'-GMP, Cyclic guanosine 3',5'-monophosphate, GUANOSINE-3',5'-cyclic-MONOPHOSPHORIC ACID, GUANOSINE-3',5'-MONOPHOSPHATE, Guanosine 3',5'-phosphate, 3',5'-guanosine monophosphate, CHEMBL395336, guanosine-cyclic-phosphoric-acid, Guanosine cyclic 3',5'-(hydrogen phosphate), Guanosine 3',5'-phosphate (cyclic), guanosine 3',5'-cyclic-monophosphate, Guanosine cyclic 3',5'-monophosphate, 2-Amino-9-((4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-1,9-dihydro-6H-purin-6-one, 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one, Guanosine, cyclic 3',5'-(hydrogen phosphate), guanosine cyclic-monophosphate, MFCD00070129, GMP, Cyclic, 2-amino-9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1,9-dihydro-6H-purin-6-one, 35G, 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-hexahydro-2??-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6,9-dihydro-1H-purin-6-one, cyclic 3',5'-guanosine monophosphate, Guanosine-3',5'-cyclic monophosphate, 3',5'-guanosine, D-Guanosine 3',5'-cyclic monophosphate, CYCLIC GMP [MI], SCHEMBL738, Epitope ID:149170, GTPL2347, 3',5'-cGMP, DTXSID8040646, SCHEMBL19222127, BDBM14391, BDBM50369127, CMC_11906, CMC_11907, AKOS016845882, Guanosine-3',5'-cyclic-monophosphate, DB02315, guanosine 3',5'-(hydrogen phosphate), GUANOSINE-3 ,5 -MONOPHOSPHATE, NG03522, AS-60024, NS00045530, C00942, G71258, Q422511, 4H-Furo[3,2-d]-1,3,2-dioxaphosphorin, guanosine deriv., 158963B3-56F4-4A85-A160-A80E1460FB19, Guanosine 3 inverted exclamation marka,5 inverted exclamation marka-cyclic monophosphate, 2-amino-9-[(1S,6R,8R,9R)-3,9-dihydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[4.3.0]nonan-8-yl]-3H-purin-6-one, 2-amino-9-[(2S,4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-1,9-dihydro-6H-purin-6-one, 231-641-6, 6H-purin-6-one, 2-amino-3,9-dihydro-9-[(4aR,6R,7R,7aS)-tetrahydro-2,7-dihydroxy-2-oxido-4H-furo[3,2-d]-1,3,2-dioxaphosphorin-6-yl]-, 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-hexahydro-1,3,5,2$l^{5}-furo[3,2-d][1,3,2$l^{5}]dioxaphosphinin-6-yl]-2-amino-6,9-dihydro-1H-purin-6-one, 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-hexahydro-1,3,5,2$l^{5}-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-6,9-dihydro-1H-purin-6-one |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 171.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCC2CC(C3CCC4C(C)CCCC43)CC2C1 |
| Np Classifier Class | Purine nucleos(t)ides |
| Deep Smiles | O[C@@H][C@@H]OP=O)O)OC[C@H]6O[C@H]9ncncc5ncN)[nH]c6=O |
| Heavy Atom Count | 23.0 |
| Classyfire Class | Purine nucleotides |
| Description | Cyclic-gmp, also known as cgmp or guanosine 3',5'-cyclic monophosphate, is a member of the class of compounds known as 3',5'-cyclic purine nucleotides. 3',5'-cyclic purine nucleotides are purine nucleotides in which the oxygen atoms linked to the C3 and C5 carbon atoms of the ribose moiety are both bonded the same phosphorus atom of the phosphate group. Cyclic-gmp is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Cyclic-gmp can be found in a number of food items such as common sage, jew's ear, java plum, and pepper (c. chinense), which makes cyclic-gmp a potential biomarker for the consumption of these food products. Cyclic-gmp can be found primarily in blood and cerebrospinal fluid (CSF), as well as throughout most human tissues. Cyclic-gmp exists in all living species, ranging from bacteria to humans. Moreover, cyclic-gmp is found to be associated with headache. |
| Scaffold Graph Node Level | OC1NCNC2C1NCN2C1CC2OP(O)OCC2O1 |
| Classyfire Subclass | Cyclic purine nucleotides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 616.0 |
| Database Name | fooddb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
| Veber Rule | False |
| Classyfire Superclass | Nucleosides, nucleotides, and analogues |
| Xlogp | -3.4 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H12N5O7P |
| Scaffold Graph Node Bond Level | O=c1[nH]cnc2c1ncn2C1CC2O[PH](=O)OCC2O1 |
| Inchi Key | ZOOGRGPOEVQQDX-UUOKFMHZSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | cyclic gmp |
| Esol Class | Very soluble |
| Functional Groups | CO, COC, COP(=O)(O)OC, c=O, cN, c[nH]c, cn(c)C, cnc |
| Compound Name | Cyclic GMP |
| Exact Mass | 345.047 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 345.047 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 345.21 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
| Smiles | C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Nucleosides |
- 1. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Reference:ISBN:9780387706375