Tilarginine Acetate
PubChem CID: 135242
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-NMMA acetate, Tilarginine Acetate, 53308-83-1, L-NMMA, NG-Monomethyl-L-arginine acetate, Targinine acetate, NG-Methyl-L-arginine acetate salt, Tilarginine acetate [USAN], Ng-methylarginine acetate, ANO-1020, UNII-2FL3530AF2, L-NMMA (acetate), DTXSID7045780, N(G)-Methyl-L-arginine acetate, 2FL3530AF2, ANO 1020, MFCD00069311, N-Omega-monomethyl-L-arginine acetate, Tilarginine acetate (USAN), DTXCID5025780, L-Ornithine, N5-[imino(methylamino)methyl]-[CAS], N5-(Imino(methylamino)methyl)-L-ornithine monoacetate, NG-METHYLARGININE ACETATE [MI], L-Ornithine, N5-(imino(methylamino)methyl)-, monoacetate, (E)-Nw'-methyl-L-arginine compound with acetic acid (1:1), (2S)-2-Amino-5-((methylcarbamimidoyl)amino)pentanoic acid monoacetate, acetic acid, (2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid, L-ORNITHINE, N(SUP 5)-(IMINO(METHYLAMINO)METHYL)-, MONOACETATE, SMR000449329, CAS-53308-83-1, NCGC00024780-01, NCGC00024780-04, (2S)-2-Amino-5-[(methylcarbamimidoyl)amino]pentanoic acid monoacetate, N5-[Imino(methylamino)methyl]-L-ornithine Acetate, L-NMMA, ANO 1020, Tilarginine Acetate, , NCGC00094091-01, Tilarginine acetate, Methylarginine acetate, H-Arg(Me)-OH.AcOH, MLS000758278, MLS001401412, MLS002172472, SCHEMBL1321022, C7H16N4O2.CH3CO2H, CHEMBL1256175, Nomega-Methyl-L-arginine Acetate, DTXSID70872413, IKPNWIGTWUZCKM-JEDNCBNOSA-N, HMS2051M15, HMS2235N20, HMS3262E22, Tox21_111246, Tox21_113520, Tox21_113578, Tox21_500750, HB1353, HY-18732A, s7920, Nomega-Methyl-L-arginine acetate salt, AKOS024458640, NG-Monomethyl-L-arginine acetate salt, CCG-100805, CCG-222054, LP00750, NC00055, N(omega)-Monomethyl-L-Arginine Acetate, NCGC00261435-01, DA-54979, FA107869, CS-0014213, EU-0100750, M1365, N5-(Methylamidino)-L-ornithine acetate salt, NG MONOMETHYL L ARGININE, ACETIC ACID, D09018, D91492, M 7033, L-NG-Monomethylarginine, Acetate Salt (L-NMMA), SR-01000597858, NG-Methyl-L-arginine acetate salt, >=98% (TLC), SR-01000597858-1, Q27254685, (S)-2-amino-5-(3-methylguanidino)pentanoic acid compound with acetic acid (1:1), 133587-00-5 |
|---|---|
| Topological Polar Surface Area | 151.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 17.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 224.0 |
| Database Name | cmaup_ingredients;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | acetic acid, (2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid |
| Prediction Hob | 1.0 |
| Molecular Formula | C9H20N4O4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | IKPNWIGTWUZCKM-JEDNCBNOSA-N |
| Fcsp3 | 0.6666666666666666 |
| Logs | -0.982 |
| Rotatable Bond Count | 6.0 |
| Logd | -1.61 |
| Compound Name | Tilarginine Acetate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 248.148 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 248.148 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 248.28 |
| Covalent Unit Count | 2.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.6089454000000003 |
| Inchi | InChI=1S/C7H16N4O2.C2H4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13, 1-2(3)4/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11), 1H3,(H,3,4)/t5-, /m0./s1 |
| Smiles | CC(=O)O.CN=C(N)NCCC[C@@H](C(=O)O)N |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Isodon Scoparius (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Isodon Xerophilus (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Kaempferia Pulchra (Plant) Rel Props:Source_db:cmaup_ingredients