Pterosin F
PubChem CID: 134978
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Pterosin F, 34175-98-9, 6-(2-chloroethyl)-2,5,7-trimethyl-2,3-dihydro-1h-inden-1-one, HJ-5, 1-Indanone, 6-(2-chloroethyl)-2,5,7-trimethyl-, (-)-, 1H-Inden-1-one, 6-(2-chloroethyl)-2,3-dihydro-2,5,7-trimethyl-, (R)-, DTXSID30955716, CHEBI:169882, 6-(2-chloroethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one, 6-(2-Chloroethyl)-2,5,7-trimethyl-(-)-1-Indanone, 6-(2-Chloroethyl)-2,3-dihydro-2,5,7-trimethyl-1H-inden-1-one, 9CI |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCCC12 |
| Np Classifier Class | Illudalane sesquiterpenoids |
| Deep Smiles | ClCCccC)cccc6C))C=O)CC5)C |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Indanes |
| Description | Constituent of Pteridium aquilinum (bracken fern). Pterosin F is found in green vegetables and root vegetables. |
| Scaffold Graph Node Level | OC1CCC2CCCCC12 |
| Classyfire Subclass | Indanones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 276.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-(2-chloroethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one |
| Nih Violation | True |
| Class | Indanes |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.8 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Indanones |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H17ClO |
| Scaffold Graph Node Bond Level | O=C1CCc2ccccc21 |
| Inchi Key | DFJCTWMNTSWCRI-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Synonyms | 1-Indanone, 6-(2-chloroethyl)-2,5,7-trimethyl-, (-)-, 6-(2-Chloroethyl)-2,3-dihydro-2,5,7-trimethyl-1H-inden-1-one, 9CI, 6-(2-Chloroethyl)-2,5,7-trimethyl-(-)-1-indanone, Pterosin F, 6-(2-Chloroethyl)-2,3-dihydro-2,5,7-trimethyl-1H-inden-1-one, 9ci, pterosin f |
| Esol Class | Soluble |
| Functional Groups | CCl, cC(C)=O |
| Compound Name | Pterosin F |
| Kingdom | Organic compounds |
| Exact Mass | 236.097 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 236.097 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 236.73 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C14H17ClO/c1-8-6-11-7-9(2)14(16)13(11)10(3)12(8)4-5-15/h6,9H,4-5,7H2,1-3H3 |
| Smiles | CC1CC2=C(C1=O)C(=C(C(=C2)C)CCCl)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Indanones |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Pteridium Aquilinum (Plant) Rel Props:Source_db:npass_chem_all