6-Keto-28-homobrassinolide
PubChem CID: 134291
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6-Keto-28-homobrassinolide |
|---|---|
| Topological Polar Surface Area | 98.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | WADMTJKRYLAHQV-JZSPVGNFSA-N |
| Rotatable Bond Count | 6.0 |
| Heavy Atom Count | 34.0 |
| Compound Name | 6-Keto-28-homobrassinolide |
| Kingdom | Organic compounds |
| Description | 6-keto-28-homobrassinolide belongs to stigmastanes and derivatives class of compounds. Those are sterol lipids with a structure based on the stigmastane skeleton, which consists of a cholestane moiety bearing an ethyl group at the carbon atom C24. 6-keto-28-homobrassinolide is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 6-keto-28-homobrassinolide can be found in tea, which makes 6-keto-28-homobrassinolide a potential biomarker for the consumption of this food product. |
| Exact Mass | 478.366 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 478.366 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 753.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 478.7 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 13.0 |
| Iupac Name | (2R,3S,5S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R,4R,5R)-5-ethyl-3,4-dihydroxy-6-methylheptan-2-yl]-2,3-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| Total Atom Stereocenter Count | 13.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Steroids and steroid derivatives |
| Inchi | InChI=1S/C29H50O5/c1-7-17(15(2)3)27(34)26(33)16(4)19-8-9-20-18-12-23(30)22-13-24(31)25(32)14-29(22,6)21(18)10-11-28(19,20)5/h15-22,24-27,31-34H,7-14H2,1-6H3/t16-,17+,18-,19+,20-,21-,22+,24-,25+,26+,27+,28+,29+/m0/s1 |
| Smiles | CC[C@@H]([C@H]([C@@H]([C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC(=O)[C@@H]4[C@@]3(C[C@H]([C@H](C4)O)O)C)C)O)O)C(C)C |
| Xlogp | 5.1 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Stigmastanes and derivatives |
| Taxonomy Direct Parent | Stigmastanes and derivatives |
| Molecular Formula | C29H50O5 |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all