[2-hydroxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate
PubChem CID: 131753022
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 225.0 |
|---|---|
| Hydrogen Bond Donor Count | 8.0 |
| Inchi Key | MPSGDHOYFIUPSO-PDBXOOCHSA-N |
| Rotatable Bond Count | 23.0 |
| State | Solid |
| Substituent Name | Glycosylmonoacylglycerol, Octadecanoid, O-glycosyl compound, Glycosyl compound, Disaccharide, Glycerol ether, Fatty acid ester, Fatty acyl, Oxane, Saccharide, Secondary alcohol, Polyol, Carboxylic acid ester, 1,2-diol, Oxacycle, Organoheterocyclic compound, Monocarboxylic acid or derivatives, Ether, Carboxylic acid derivative, Acetal, Hydrocarbon derivative, Primary alcohol, Organooxygen compound, Carbonyl group, Alcohol, Aliphatic heteromonocyclic compound |
| Synonyms | 3'-O-Linolenoylglyceryl 6-O-galactopyranosyl-galactopyranoside, 2-Hydroxy-3-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}propyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid, Gingerglycolipid a |
| Heavy Atom Count | 47.0 |
| Compound Name | [2-hydroxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| Kingdom | Organic compounds |
| Description | Constituent of Zingiber officinale (ginger). Gingerglycolipid A is found in herbs and spices and ginger. |
| Exact Mass | 676.367 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 676.367 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 929.0 |
| Hydrogen Bond Acceptor Count | 14.0 |
| Molecular Weight | 676.8 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [2-hydroxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| Total Atom Stereocenter Count | 11.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 3.0 |
| Class | Glycerolipids |
| Inchi | InChI=1S/C33H56O14/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25(36)43-19-22(35)20-44-32-31(42)29(40)27(38)24(47-32)21-45-33-30(41)28(39)26(37)23(18-34)46-33/h3-4,6-7,9-10,22-24,26-35,37-42H,2,5,8,11-21H2,1H3/b4-3-,7-6-,10-9- |
| Smiles | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(COC1C(C(C(C(O1)COC2C(C(C(C(O2)CO)O)O)O)O)O)O)O |
| Xlogp | 1.2 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 3.0 |
| Subclass | Glycosylglycerols |
| Taxonomy Direct Parent | Glycosylmonoacylglycerols |
| Molecular Formula | C33H56O14 |
- 1. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:fooddb_chem_all