(R)-Apiumetin
PubChem CID: 131752966
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (R)-Apiumetin, CHEBI:174260, 9-hydroxy-2-prop-1-en-2-yl-2,3-dihydrouro[3,2-g]chromen-7-one |
|---|---|
| Topological Polar Surface Area | 55.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | VIUKEEZPYOJNOJ-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 2,3-Dihydro-9-hydroxy-2-(1-methylethenyl)-7H-furo[3,2-g][1]benzopyran-7-one, 9CI, Leptophyllidin |
| Heavy Atom Count | 18.0 |
| Compound Name | (R)-Apiumetin |
| Description | Constituent of the seeds of Apium graveolens. (R)-Apiumetin is found in green vegetables. |
| Exact Mass | 244.074 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 244.074 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 414.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 244.24 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 9-hydroxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-7-one |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C14H12O4/c1-7(2)10-6-9-5-8-3-4-11(15)18-13(8)12(16)14(9)17-10/h3-5,10,16H,1,6H2,2H3 |
| Smiles | CC(=C)C1CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)O |
| Xlogp | 2.9 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C14H12O4 |
- 1. Outgoing r'ship
FOUND_INto/from Apium Graveolens (Plant) Rel Props:Source_db:fooddb_chem_all