Aromadendrin 4'-methyl ether 7-rhamnoside
PubChem CID: 131752855
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Aromadendrin 4'-methyl ether 7-rhamnoside, Dihydrokaempferide 7-rhamnoside, CHEBI:176134, DTXSID701105638, 114847-26-6, 3,5-dihydroxy-2-(4-methoxyphenyl)-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3-dihydrochromen-4-one, 4H-1-Benzopyran-4-one, 7-[(6-deoxy-I+/--L-mannopyranosyl)oxy]-2,3-dihydro-3,5-dihydroxy-2-(4-methoxyphenyl)-, (2R-trans)- |
|---|---|
| Topological Polar Surface Area | 155.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | KDOAIGQCYMINEB-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | Aromadendrin 4'-methyl ether 7-rhamnoside, Dihydrokaempferide 7-rhamnoside |
| Heavy Atom Count | 32.0 |
| Compound Name | Aromadendrin 4'-methyl ether 7-rhamnoside |
| Description | Constituent of the fruit of orange (Citrus sinensis). Aromadendrin 4'-methyl ether 7-rhamnoside is found in sweet orange and citrus. |
| Exact Mass | 448.137 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 448.137 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 653.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 448.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,5-dihydroxy-2-(4-methoxyphenyl)-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3-dihydrochromen-4-one |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C22H24O10/c1-9-16(24)18(26)20(28)22(30-9)31-12-7-13(23)15-14(8-12)32-21(19(27)17(15)25)10-3-5-11(29-2)6-4-10/h3-9,16,18-24,26-28H,1-2H3 |
| Smiles | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(C(C3=O)O)C4=CC=C(C=C4)OC)O)O)O)O |
| Xlogp | 0.9 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C22H24O10 |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all