5-Hydroxy-4,4',6-trimethoxyaurone
PubChem CID: 131752787
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5-Hydroxy-4,4',6-trimethoxyaurone, CHEBI:174403, (2E)-5-hydroxy-4,6-dimethoxy-2-[(4-methoxyphenyl)methylidene]-1-benzouran-3-one |
|---|---|
| Topological Polar Surface Area | 74.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | SDBGODOJRLLNSU-RIYZIHGNSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | 5-Hydroxy-4,4',6-trimethoxyaurone, 5-Hydroxy-4,6,4'-trimethoxyaurone |
| Heavy Atom Count | 24.0 |
| Compound Name | 5-Hydroxy-4,4',6-trimethoxyaurone |
| Description | Isolated from the flowers of Helianthus annuus (sunflower). 5-Hydroxy-4,4',6-trimethoxyaurone is found in sunflower and fats and oils. |
| Exact Mass | 328.095 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 328.095 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 482.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 328.3 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E)-5-hydroxy-4,6-dimethoxy-2-[(4-methoxyphenyl)methylidene]-1-benzofuran-3-one |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)8-14-16(19)15-12(24-14)9-13(22-2)17(20)18(15)23-3/h4-9,20H,1-3H3/b14-8+ |
| Smiles | COC1=CC=C(C=C1)/C=C/2\C(=O)C3=C(C(=C(C=C3O2)OC)O)OC |
| Xlogp | 3.2 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C18H16O6 |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all