Luteone 7-glucoside
PubChem CID: 131752607
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Luteone 7-glucoside, Iuteone 7-O-glucoside, CHEBI:191631, 5,7,2',4'-Tetrahydroxy-6-prenylisoflavone 7-O-glucoside, 3-(2,4-dihydroxyphenyl)-5-hydroxy-6-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| Topological Polar Surface Area | 186.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Inchi Key | DOIIPZVFYVWPPS-UHFFFAOYSA-N |
| Rotatable Bond Count | 6.0 |
| Synonyms | 2',4',5,7-Tetrahydroxy-6-prenylisoflavone 7-O-b-D-glucopyranoside, 5,7,2',4'-Tetrahydroxy-6-prenylisoflavone 7-O-glucoside, Iuteone 7-O-glucoside, Luteone 7-glucoside, Luteone 7-O-glucoside |
| Heavy Atom Count | 37.0 |
| Compound Name | Luteone 7-glucoside |
| Description | Isolated from the roots of Lupinus albus (white lupin). Luteone 7-glucoside is found in pulses and white lupine. |
| Exact Mass | 516.163 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 516.163 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 871.0 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 516.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-(2,4-dihydroxyphenyl)-5-hydroxy-6-(3-methylbut-2-enyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C26H28O11/c1-11(2)3-5-14-17(36-26-25(34)24(33)23(32)19(9-27)37-26)8-18-20(21(14)30)22(31)15(10-35-18)13-6-4-12(28)7-16(13)29/h3-4,6-8,10,19,23-30,32-34H,5,9H2,1-2H3 |
| Smiles | CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=C(C=C(C=C3)O)O)OC4C(C(C(C(O4)CO)O)O)O)C |
| Xlogp | 2.4 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C26H28O11 |
- 1. Outgoing r'ship
FOUND_INto/from Lupinus Albus (Plant) Rel Props:Source_db:fooddb_chem_all