Citrusin F
PubChem CID: 131752582
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Citrusin F, CHEBI:169466, methyl 3-[3-hydroxy-4-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]propanoate |
|---|---|
| Topological Polar Surface Area | 225.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Inchi Key | YLQXQJFWCRRNGA-UHFFFAOYSA-N |
| Rotatable Bond Count | 10.0 |
| Synonyms | Citrusin F, Methyl 3-(3-hydroxy-4-{[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}phenyl)propanoic acid |
| Heavy Atom Count | 36.0 |
| Compound Name | Citrusin F |
| Kingdom | Organic compounds |
| Description | Isolated from lemon peel oil (Citrus limon). Citrusin F is found in lemon and citrus. |
| Exact Mass | 520.179 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 520.179 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 696.0 |
| Hydrogen Bond Acceptor Count | 14.0 |
| Molecular Weight | 520.5 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | methyl 3-[3-hydroxy-4-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl]propanoate |
| Total Atom Stereocenter Count | 10.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Organooxygen compounds |
| Inchi | InChI=1S/C22H32O14/c1-32-14(25)5-3-9-2-4-11(10(24)6-9)34-22-20(31)18(29)16(27)13(36-22)8-33-21-19(30)17(28)15(26)12(7-23)35-21/h2,4,6,12-13,15-24,26-31H,3,5,7-8H2,1H3 |
| Smiles | COC(=O)CCC1=CC(=C(C=C1)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
| Xlogp | -2.7 |
| Superclass | Organic oxygen compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Taxonomy Direct Parent | Phenolic glycosides |
| Molecular Formula | C22H32O14 |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Limon (Plant) Rel Props:Source_db:fooddb_chem_all