(2E,6E)-Piperamide-C7:2
PubChem CID: 131752413
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Sarmentosine?, (2E,6E)-Piperamide-C7:2, Piperamide-C7:2 (2E,6E) |
|---|---|
| Topological Polar Surface Area | 38.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | RUXALYXWBMBHLF-KYPMKJFLSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | Piperamide-C7:2 (2E,6E), Sarmentosine? |
| Heavy Atom Count | 22.0 |
| Compound Name | (2E,6E)-Piperamide-C7:2 |
| Description | Constituent of the fruits of pepper (Piper nigrum) and cha-plu (Piper sarmentosum) (Piperaceae). (2E,6E)-Piperamide-C7:2 is found in herbs and spices and pepper (spice). |
| Exact Mass | 299.152 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 299.152 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 426.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 299.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,6Z)-7-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylhepta-2,6-dien-1-one |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C18H21NO3/c20-18(19-11-5-6-12-19)8-4-2-1-3-7-15-9-10-16-17(13-15)22-14-21-16/h3-4,7-10,13H,1-2,5-6,11-12,14H2/b7-3-,8-4+ |
| Smiles | C1CCN(C1)C(=O)/C=C/CC/C=C\C2=CC3=C(C=C2)OCO3 |
| Xlogp | 3.7 |
| Defined Bond Stereocenter Count | 2.0 |
| Molecular Formula | C18H21NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all