(2E,4E,8E)-Piperamide-C9:3
PubChem CID: 131752410
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (2E,4E,8E)-Piperamide-C9:3, Piperamide-C9:3 (2E,4E,8E) |
|---|---|
| Topological Polar Surface Area | 38.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | XWQSYLYFCJTIEL-JWXNOOABSA-N |
| Rotatable Bond Count | 6.0 |
| Synonyms | Piperamide-C9:3 (2E,4E,8E) |
| Heavy Atom Count | 24.0 |
| Compound Name | (2E,4E,8E)-Piperamide-C9:3 |
| Description | Constituent of pepper fruits (Piper nigrum, Piperaceae). (2E,4E,8E)-Piperamide-C9:3 is found in herbs and spices and pepper (spice). |
| Exact Mass | 325.168 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 325.168 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 491.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 325.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,4E,8Z)-9-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylnona-2,4,8-trien-1-one |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 3.0 |
| Inchi | InChI=1S/C20H23NO3/c22-20(21-13-7-8-14-21)10-6-4-2-1-3-5-9-17-11-12-18-19(15-17)24-16-23-18/h2,4-6,9-12,15H,1,3,7-8,13-14,16H2/b4-2+,9-5-,10-6+ |
| Smiles | C1CCN(C1)C(=O)/C=C/C=C/CC/C=C\C2=CC3=C(C=C2)OCO3 |
| Xlogp | 4.0 |
| Defined Bond Stereocenter Count | 3.0 |
| Molecular Formula | C20H23NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all