Glycinoprenol 9
PubChem CID: 131752395
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Glycinoprenol 9, CHEBI:185274, (2E,6E,10Z,14Z,18Z,22E)-3,7,11,15,19,23,27,31,35-NONAMETHYLHEXATRIACONTA-2,6,10,14,18,22-HEXAEN-1-OL |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 46.0 |
| Description | Constituent of Glycine max (soybean). Glycinoprenol 9 is found in soy bean and pulses. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 934.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,6E,10Z,14Z,18Z,22E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22-hexaen-1-ol |
| Nih Violation | True |
| Class | Prenol lipids |
| Xlogp | 17.5 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Polyprenols |
| Molecular Formula | C45H80O |
| Inchi Key | FWVIPKAFIXXKIW-NSAJWJIGSA-N |
| Rotatable Bond Count | 28.0 |
| Compound Name | Glycinoprenol 9 |
| Kingdom | Organic compounds |
| Exact Mass | 636.621 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 636.621 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 637.1 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 6.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C45H80O/c1-37(2)19-11-20-38(3)21-12-22-39(4)23-13-24-40(5)25-14-26-41(6)27-15-28-42(7)29-16-30-43(8)31-17-32-44(9)33-18-34-45(10)35-36-46/h25,27,29,31,33,35,37-39,46H,11-24,26,28,30,32,34,36H2,1-10H3/b40-25+,41-27-,42-29-,43-31-,44-33+,45-35+ |
| Smiles | CC(C)CCCC(C)CCCC(C)CCC/C(=C/CC/C(=C\CC/C(=C\CC/C(=C\CC/C(=C/CC/C(=C/CO)/C)/C)/C)/C)/C)/C |
| Defined Bond Stereocenter Count | 6.0 |
| Taxonomy Direct Parent | Polyprenols |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all