(2Z,6E,10E,14E,18E,22Z,26E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26-heptaen-1-ol
PubChem CID: 131752394
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 20.2 |
|---|---|
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | VXLKCFIDVJZHGS-GAZVJNJYSA-N |
| Rotatable Bond Count | 31.0 |
| Heavy Atom Count | 51.0 |
| Compound Name | (2Z,6E,10E,14E,18E,22Z,26E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26-heptaen-1-ol |
| Kingdom | Organic compounds |
| Description | Constituent of Glycine max (soybean). Glycinoprenol 10 is found in soy bean and pulses. |
| Exact Mass | 704.684 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 704.684 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1080.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 705.2 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2Z,6E,10E,14E,18E,22Z,26E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-2,6,10,14,18,22,26-heptaen-1-ol |
| Total Atom Stereocenter Count | 2.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Total Bond Stereocenter Count | 7.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C50H88O/c1-41(2)21-12-22-42(3)23-13-24-43(4)25-14-26-44(5)27-15-28-45(6)29-16-30-46(7)31-17-32-47(8)33-18-34-48(9)35-19-36-49(10)37-20-38-50(11)39-40-51/h27,29,31,33,35,37,39,41-43,51H,12-26,28,30,32,34,36,38,40H2,1-11H3/b44-27+,45-29-,46-31+,47-33+,48-35+,49-37+,50-39- |
| Smiles | CC(C)CCCC(C)CCCC(C)CCC/C(=C/CC/C(=C\CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C\CO)/C)/C)/C)/C)/C)/C)/C |
| Xlogp | 19.3 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 7.0 |
| Subclass | Polyprenols |
| Taxonomy Direct Parent | Polyprenols |
| Molecular Formula | C50H88O |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all