Delphinidin 3-rhamnoside 5-glucoside
PubChem CID: 131752270
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Delphinidin 3-rhamnoside 5-glucoside, Delphinidin 5-glucoside 3-rhamnoside |
|---|---|
| Topological Polar Surface Area | 260.0 |
| Hydrogen Bond Donor Count | 11.0 |
| Inchi Key | IEMQNRLOUXMJQV-UHFFFAOYSA-O |
| Rotatable Bond Count | 6.0 |
| Synonyms | Delphinidin 5-glucoside 3-rhamnoside |
| Heavy Atom Count | 43.0 |
| Compound Name | Delphinidin 3-rhamnoside 5-glucoside |
| Description | Isolated from peas and beans. Delphinidin 3-rhamnoside 5-glucoside is found in pulses and common pea. |
| Exact Mass | 611.161 |
| Formal Charge | 1.0 |
| Monoisotopic Mass | 611.161 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 902.0 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 611.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[7-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C27H30O16/c1-8-18(32)21(35)23(37)26(39-8)42-16-6-11-14(40-25(16)9-2-12(30)19(33)13(31)3-9)4-10(29)5-15(11)41-27-24(38)22(36)20(34)17(7-28)43-27/h2-6,8,17-18,20-24,26-28,32,34-38H,7H2,1H3,(H3-,29,30,31,33)/p+1 |
| Smiles | CC1C(C(C(C(O1)OC2=C([O+]=C3C=C(C=C(C3=C2)OC4C(C(C(C(O4)CO)O)O)O)O)C5=CC(=C(C(=C5)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C27H31O16+ |
- 1. Outgoing r'ship
FOUND_INto/from Pisum Sativum (Plant) Rel Props:Source_db:fooddb_chem_all