Artenolide
PubChem CID: 131752206
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Artenolide, (3'S,3aS,6'S,7'S,9bS,10'S)-6,8,9,10'-tetrahydroxy-1',6,6',9,10'-pentamethylspiro(3a,4,5,8,9a,9b-hexahydroazuleno(4,5-b)furan-3,13'-4-oxatetracyclo(10.2.1.02,11.03,7)pentadec-2(11)-ene)-2,5'-dione, (3'S,3aS,6'S,7'S,9bS,10'S)-6,8,9,10'-tetrahydroxy-1',6,6',9,10'-pentamethylspiro[3a,4,5,8,9a,9b-hexahydroazuleno[4,5-b]furan-3,13'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-2,5'-dione, CHEBI:175952, (3'S,3aS,6'S,7'S,9bS,10'S)-6,8,9,10'-tetrahydroxy-1',6,6',9,10'-pentamethylspiro[3a,4,5,8,9a,9b-hexahydroazuleno[4,5-b]uran-3,13'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-2,5'-dione |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 134.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC2CCCC3C(C4CC3C3(C4)C(C)CC4C5CCCC5CCCC43)C2C1 |
| Deep Smiles | C[C@@H]C=O)O[C@H][C@H]5CC[C@]C=C7CC)CC5CC5)C=O)O[C@H][C@H]5CCCC=CCCC%105)C)O))O))))C)O))))))))))))))C)O |
| Heavy Atom Count | 38.0 |
| Classyfire Class | Lactones |
| Description | Constituent of Artemisia absinthium (wormwood). Artenolide is found in alcoholic beverages and herbs and spices. |
| Scaffold Graph Node Level | OC1CC2CCCC3C(C4CC3C3(C4)C(O)OC4C5CCCC5CCCC43)C2O1 |
| Classyfire Subclass | Gamma butyrolactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1220.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (3'S,3aS,6'S,7'S,9bS,10'S)-6,8,9,10'-tetrahydroxy-1',6,6',9,10'-pentamethylspiro[3a,4,5,8,9a,9b-hexahydroazuleno[4,5-b]furan-3,13'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-2,5'-dione |
| Class | Lactones |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | -0.1 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Gamma butyrolactones |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H40O8 |
| Scaffold Graph Node Bond Level | O=C1CC2CCCC3=C(C4CC3C3(C4)C(=O)OC4C5CCC=C5CCCC43)C2O1 |
| Inchi Key | INWDFSUZZFAFBJ-HXCFRXSLSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Synonyms | artenolide |
| Esol Class | Soluble |
| Functional Groups | CC(=O)OC, CC(C)=C(C)C, CC=C(C)C, CO, COC(C)=O |
| Compound Name | Artenolide |
| Kingdom | Organic compounds |
| Exact Mass | 528.272 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 528.272 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 528.6 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 13.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C30H40O8/c1-13-14-6-8-28(4,35)19-17-11-26(2,21(19)22(14)37-24(13)32)12-30(17)15-7-9-27(3,34)16-10-18(31)29(5,36)20(16)23(15)38-25(30)33/h10,13-15,17-18,20,22-23,31,34-36H,6-9,11-12H2,1-5H3/t13-,14-,15+,17?,18?,20?,22-,23-,26?,27?,28-,29?,30?/m0/s1 |
| Smiles | C[C@H]1[C@@H]2CC[C@](C3=C([C@H]2OC1=O)C4(CC3C5(C4)[C@@H]6CCC(C7=CC(C(C7[C@H]6OC5=O)(C)O)O)(C)O)C)(C)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Gamma butyrolactones |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Artemisia Absinthium (Plant) Rel Props:Reference:ISBN:9788185042114