(-)-Epicatechin 6-C-glucoside
PubChem CID: 131752183
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Epicatechin 6-C-glucoside, 6-Glucosyl-(-)-epicatechin, 6-Glucopyranosyl-(-)-epicatechin, CHEBI:191607, (2R,3R)-2-(3,4-dihydroxyphenyl)-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| Topological Polar Surface Area | 201.0 |
| Hydrogen Bond Donor Count | 9.0 |
| Inchi Key | PWMSPKVTJLJDDS-NOCOPWLTSA-N |
| Rotatable Bond Count | 3.0 |
| Substituent Name | Flavonoid c-glycoside, Catechin, Hydroxyflavonoid, Flavan-3-ol, 7-hydroxyflavonoid, 5-hydroxyflavonoid, 4'-hydroxyflavonoid, 3-hydroxyflavonoid, 3'-hydroxyflavonoid, Flavan, Glycosyl compound, C-glycosyl compound, 1-benzopyran, Benzopyran, Chromane, Resorcinol, 1,2-diphenol, Phenol, Alkyl aryl ether, Benzenoid, Oxane, Monosaccharide, Saccharide, Monocyclic benzene moiety, Secondary alcohol, Polyol, 1,2-diol, Oxacycle, Organoheterocyclic compound, Ether, Dialkyl ether, Hydrocarbon derivative, Primary alcohol, Organooxygen compound, Alcohol, Aromatic heteropolycyclic compound |
| Synonyms | (-)-Epicatechin 6-C-glucoside, 6-C-Glucopyranosylepicatechin, 6-Glucopyranosyl-(-)-epicatechin, 6-Glucosyl-(-)-epicatechin, Epicatechin 6-C-glucoside |
| Heavy Atom Count | 32.0 |
| Compound Name | (-)-Epicatechin 6-C-glucoside |
| Kingdom | Organic compounds |
| Description | Isolated from bark of Chinese cinnamon Cinnamomum cassia. Epicatechin 6-C-glucoside is found in chinese cinnamon and herbs and spices. |
| Exact Mass | 452.132 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 452.132 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 637.0 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 452.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Class | Flavonoids |
| Inchi | InChI=1S/C21H24O11/c22-6-14-17(28)18(29)19(30)21(32-14)15-11(25)5-13-8(16(15)27)4-12(26)20(31-13)7-1-2-9(23)10(24)3-7/h1-3,5,12,14,17-30H,4,6H2/t12-,14-,17-,18+,19-,20-,21?/m1/s1 |
| Smiles | C1[C@H]([C@H](OC2=C1C(=C(C(=C2)O)C3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)C4=CC(=C(C=C4)O)O)O |
| Xlogp | -1.0 |
| Superclass | Phenylpropanoids and polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Flavonoid glycosides |
| Molecular Formula | C21H24O11 |
- 1. Outgoing r'ship
FOUND_INto/from Cinnamomum Cassia (Plant) Rel Props:Source_db:fooddb_chem_all