7',8'-Dihydro-e,y-carotene
PubChem CID: 131752085
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-Zeacarotene, 7',8'-Dihydro-e,y-carotene |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 40.0 |
| Description | Constituent of corn gluten. alpha-Zeacarotene is found in cereals and cereal products and corn. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1120.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-[(1E,3Z,5E,7E,9E,11Z,13E,15E,19Z)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,19,23-decaenyl]-1,5,5-trimethylcyclohexene |
| Nih Violation | True |
| Class | Prenol lipids |
| Xlogp | 14.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Tetraterpenoids |
| Molecular Formula | C40H58 |
| Inchi Key | IGABZIVJSNQMPZ-XWGRIQFUSA-N |
| Rotatable Bond Count | 14.0 |
| Synonyms | 7',8'-Dihydro-e,y-carotene, 7',8'-dihydro-epsilon,psi-carotene, Alpha-zeacarotene, a-Zeacarotene, Α-zeacarotene, 7',8'-dihydro-e,Y-carotene, 7',8'-dihydro-epsilon,Psi-carotene, Zeacarotene, beta-Zeacarotene, Zeacarotene, (6R)-isomer, alpha-Zeacarotene, Zeacarotene, (trans)-isomer |
| Compound Name | 7',8'-Dihydro-e,y-carotene |
| Kingdom | Organic compounds |
| Exact Mass | 538.454 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 538.454 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 538.9 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 9.0 |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Inchi | InChI=1S/C40H58/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-12,14,16,18-20,22-25,27-30,39H,13,15,17,21,26,31H2,1-10H3/b12-11+,22-14+,23-16+,30-29+,33-19-,34-20+,35-24-,36-25+,37-27- |
| Smiles | CC1=CCCC(C1/C=C/C(=C\C=C\C(=C\C=C\C=C(\C)/C=C/C=C(\C)/CC/C=C(/C)\CCC=C(C)C)\C)/C)(C)C |
| Defined Bond Stereocenter Count | 9.0 |
| Taxonomy Direct Parent | Carotenes |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all