1,6,9-Farnesatriene-3,11-diol
PubChem CID: 131752076
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1,6,9-Farnesatriene-3,11-diol, CHEBI:191584, 2,6,10-Trimethyl-3,6,11-dodecatriene-2,10-diol, (3E,6Z)-2,6,10-TRIMETHYLDODECA-3,6,11-TRIENE-2,10-DIOL |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | WPGYCMWKXXCJMW-JSJZFMHOSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | 2,6,10-Trimethyl-3,6,11-dodecatriene-2,10-diol |
| Heavy Atom Count | 17.0 |
| Compound Name | 1,6,9-Farnesatriene-3,11-diol |
| Description | Constituent of Solanum melongena (aubergine). 1,6,9-Farnesatriene-3,11-diol is found in fruits and eggplant. |
| Exact Mass | 238.193 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 238.193 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 300.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 238.37 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (3E,6Z)-2,6,10-trimethyldodeca-3,6,11-triene-2,10-diol |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C15H26O2/c1-6-15(5,17)12-8-10-13(2)9-7-11-14(3,4)16/h6-7,10-11,16-17H,1,8-9,12H2,2-5H3/b11-7+,13-10- |
| Smiles | C/C(=C/CCC(C)(C=C)O)/C/C=C/C(C)(C)O |
| Xlogp | 3.0 |
| Defined Bond Stereocenter Count | 2.0 |
| Molecular Formula | C15H26O2 |
- 1. Outgoing r'ship
FOUND_INto/from Solanum Melongena (Plant) Rel Props:Source_db:fooddb_chem_all