Phytoene 1,2-epoxide
PubChem CID: 131752073
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Phytoene 1,2-epoxide, 1,2-Epoxy-1,2,7,7',8,8',11,11',12,12'-decahydro-psi,psi-carotene, 1,2-Epoxy-1,2,7,7',8,8',11,11',12,12'-decahydro-y,y-carotene |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 12.5 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC1 |
| Np Classifier Class | Carotenoids (C40, Ψ-Ψ) |
| Deep Smiles | C/C=CC=CC=CCC/C=C/CC/C=CCCCOC3C)C))))))/C)))))C)))))/C))))))/CC/C=CCC/C=CCCC=CC)C)))))/C)))))/C |
| Heavy Atom Count | 41.0 |
| Classyfire Class | Prenol lipids |
| Description | Isolated from ripe tomatoes. Phytoene 1,2-epoxide is found in garden tomato and garden tomato (variety). |
| Scaffold Graph Node Level | C1CO1 |
| Classyfire Subclass | Sesquaterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1010.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-[(3Z,7E,11E,13E,15E,19Z,23Z)-3,7,11,16,20,24,28-heptamethylnonacosa-3,7,11,13,15,19,23,27-octaenyl]-2,2-dimethyloxirane |
| Nih Violation | True |
| Class | Prenol lipids |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 14.1 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Sesquaterpenoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C40H64O |
| Scaffold Graph Node Bond Level | C1CO1 |
| Inchi Key | BCPVRLMAESAYCE-AFWJVYGRSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 20.0 |
| Synonyms | 1,2-Epoxy-1,2,7,7',8,8',11,11',12,12'-decahydro-psi,psi-carotene, 1,2-Epoxy-1,2,7,7',8,8',11,11',12,12'-decahydro-y,y-carotene, Phytoene 1,2-epoxide, phytoene epoxide(1,2-epoxy-1,2,7,8,11,12,7', 8',11',12'-decahydro-ψ,ψ-carotene) |
| Esol Class | Soluble |
| Functional Groups | C/C(C)=C/C=C/C=C(/C)C, C/C=C(/C)C, C/C=C(C)C, CC1OC1(C)C, CC=C(C)C |
| Compound Name | Phytoene 1,2-epoxide |
| Kingdom | Organic compounds |
| Exact Mass | 560.496 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 560.496 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 560.9 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 7.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C40H64O/c1-32(2)18-13-21-35(5)24-16-27-36(6)25-14-22-33(3)19-11-12-20-34(4)23-15-26-37(7)28-17-29-38(8)30-31-39-40(9,10)41-39/h11-12,18-20,24-26,29,39H,13-17,21-23,27-28,30-31H2,1-10H3/b12-11+,33-19+,34-20+,35-24-,36-25-,37-26+,38-29- |
| Smiles | CC(=CCC/C(=C\CC/C(=C\CC/C(=C/C=C/C=C(\C)/CC/C=C(\C)/CC/C=C(/C)\CCC1C(O1)(C)C)/C)/C)/C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 7.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Sesquaterpenoids |
| Np Classifier Superclass | Carotenoids (C40) |
- 1. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Source_db:fooddb_chem_all