ent-19-Trachylobanal
PubChem CID: 131752062
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ent-19-Trachylobanal |
|---|---|
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | KHSBNJXREDZLMJ-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 19-Trachylobanal, ent-19-Trachylobanal |
| Heavy Atom Count | 21.0 |
| Compound Name | ent-19-Trachylobanal |
| Description | Isolated from sunflowers. 19-Trachylobanal is found in sunflower and fats and oils. |
| Exact Mass | 286.23 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 286.23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 526.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 286.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,9,13-trimethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-5-carbaldehyde |
| Total Atom Stereocenter Count | 8.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C20H30O/c1-17(12-21)6-4-7-18(2)15(17)5-8-20-10-14-13(9-16(18)20)19(14,3)11-20/h12-16H,4-11H2,1-3H3 |
| Smiles | CC1(CCCC2(C1CCC34C2CC5C(C3)C5(C4)C)C)C=O |
| Xlogp | 5.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H30O |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all