Taraxinic acid glucosyl ester
PubChem CID: 131751687
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Taraxinic acid glucosyl ester, (-)-Taraxinic acid beta-glucopyranosyl ester, (3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl) (6E,10Z)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca(b)furan-6-carboxylate, [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (6E,10Z)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate, 3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl 10-methyl-3-methylidene-2-oxo-2H,3H,3ah,4H,5H,8H,9H,11ah-cyclodeca(b)furan-6-carboxylic acid, 3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl 10-methyl-3-methylidene-2-oxo-2H,3H,3ah,4H,5H,8H,9H,11ah-cyclodeca[b]furan-6-carboxylic acid, Taraxinate glucosyl ester, CHEBI:172666, 75911-14-7, Taraxinic acid beta-glucopyranosyl ester, [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (6E,10Z)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]uran-6-carboxylate |
|---|---|
| Topological Polar Surface Area | 143.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | SIOXYUXOHTZOOM-INAGUISBSA-N |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | (-)-Taraxinic acid beta-glucopyranosyl ester, Taraxinic acid beta-glucopyranosyl ester, Taraxinic acid glucosyl ester, Taraxinate glucosyl ester, 3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl 10-methyl-3-methylidene-2-oxo-2H,3H,3ah,4H,5H,8H,9H,11ah-cyclodeca[b]furan-6-carboxylic acid |
| Heavy Atom Count | 30.0 |
| Compound Name | Taraxinic acid glucosyl ester |
| Kingdom | Organic compounds |
| Description | Constituent of Taraxacum officinale (dandelion). Taraxinic acid glucosyl ester is found in many foods, some of which are coffee and coffee products, dandelion, tea, and alcoholic beverages. |
| Exact Mass | 424.173 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 424.173 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 756.0 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 424.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (6E,10Z)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxylate |
| Total Atom Stereocenter Count | 7.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 2.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C21H28O9/c1-10-4-3-5-12(6-7-13-11(2)19(26)28-14(13)8-10)20(27)30-21-18(25)17(24)16(23)15(9-22)29-21/h5,8,13-18,21-25H,2-4,6-7,9H2,1H3/b10-8-,12-5+ |
| Smiles | C/C/1=C/C2C(CC/C(=C\CC1)/C(=O)OC3C(C(C(C(O3)CO)O)O)O)C(=C)C(=O)O2 |
| Xlogp | 0.4 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 2.0 |
| Subclass | Terpene lactones |
| Taxonomy Direct Parent | Germacranolides and derivatives |
| Molecular Formula | C21H28O9 |
- 1. Outgoing r'ship
FOUND_INto/from Taraxacum Officinale (Plant) Rel Props:Source_db:fooddb_chem_all