Homofukinolide
PubChem CID: 131751601
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Homofukinolide |
|---|---|
| Topological Polar Surface Area | 78.9 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | SRBBDMVRDLLMJD-VOMDNODZSA-N |
| Rotatable Bond Count | 6.0 |
| Synonyms | Homofukinolide |
| Heavy Atom Count | 31.0 |
| Compound Name | Homofukinolide |
| Description | Constituent of Petasites japonicus (sweet coltsfoot). Homofukinolide is found in giant butterbur and green vegetables. |
| Exact Mass | 430.236 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 430.236 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 867.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 430.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [7,7a-dimethyl-3-[(E)-2-methylbut-2-enoyl]oxy-4'-methylidene-2'-oxospiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-4-yl] (E)-2-methylbut-2-enoate |
| Total Atom Stereocenter Count | 6.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C25H34O6/c1-8-14(3)21(26)30-18-11-10-16(5)24(7)13-25(17(6)12-29-23(25)28)20(19(18)24)31-22(27)15(4)9-2/h8-9,16,18-20H,6,10-13H2,1-5,7H3/b14-8+,15-9+ |
| Smiles | C/C=C(\C)/C(=O)OC1CCC(C2(C1C(C3(C2)C(=C)COC3=O)OC(=O)/C(=C/C)/C)C)C |
| Xlogp | 4.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 2.0 |
| Molecular Formula | C25H34O6 |
- 1. Outgoing r'ship
FOUND_INto/from Petasites Japonicus (Plant) Rel Props:Source_db:fooddb_chem_all