8-Hydroxy-4'-methoxypinoresinol
PubChem CID: 131751406
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 8-Hydroxy-4'-methoxypinoresinol, CHEBI:175935, 6-(3,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-uro[3,4-c]uran-3a-ol |
|---|---|
| Topological Polar Surface Area | 86.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | JDOYVXXEQQTICM-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | 8-Hydroxy-4'-methoxypinoresinol |
| Heavy Atom Count | 28.0 |
| Compound Name | 8-Hydroxy-4'-methoxypinoresinol |
| Description | Constituent of Olea europaea (olive). 8-Hydroxy-4'-methoxypinoresinol is found in many foods, some of which are pomes, olive, fats and oils, and herbs and spices. |
| Exact Mass | 388.152 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 388.152 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 531.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 388.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-(3,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C21H24O7/c1-24-16-7-5-12(8-18(16)26-3)19-14-10-27-20(21(14,23)11-28-19)13-4-6-15(22)17(9-13)25-2/h4-9,14,19-20,22-23H,10-11H2,1-3H3 |
| Smiles | COC1=C(C=C(C=C1)C2C3COC(C3(CO2)O)C4=CC(=C(C=C4)O)OC)OC |
| Xlogp | 1.6 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C21H24O7 |
- 1. Outgoing r'ship
FOUND_INto/from Olea Europaea (Plant) Rel Props:Source_db:fooddb_chem_all