8-Acetoxy-4'-methoxypinoresinol
PubChem CID: 131751405
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 8-Acetoxy-4'-methoxypinoresinol, CHEBI:186344, [6-(3,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-uro[3,4-c]uran-3a-yl] acetate |
|---|---|
| Topological Polar Surface Area | 92.7 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | ZVILPMKYRJCFAE-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | 8-Acetoxy-4'-methoxypinoresinol |
| Heavy Atom Count | 31.0 |
| Compound Name | 8-Acetoxy-4'-methoxypinoresinol |
| Description | Constituent of Olea europaea (olive). 8-Acetoxy-4'-methoxypinoresinol is found in many foods, some of which are olive, herbs and spices, pomes, and fats and oils. |
| Exact Mass | 430.163 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 430.163 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 629.0 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 430.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [6-(3,4-dimethoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-yl] acetate |
| Total Atom Stereocenter Count | 4.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C23H26O8/c1-13(24)31-23-12-30-21(14-6-8-18(26-2)20(9-14)28-4)16(23)11-29-22(23)15-5-7-17(25)19(10-15)27-3/h5-10,16,21-22,25H,11-12H2,1-4H3 |
| Smiles | CC(=O)OC12COC(C1COC2C3=CC(=C(C=C3)O)OC)C4=CC(=C(C=C4)OC)OC |
| Xlogp | 2.1 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C23H26O8 |
- 1. Outgoing r'ship
FOUND_INto/from Olea Europaea (Plant) Rel Props:Source_db:fooddb_chem_all