(Z)-4',6-Dihydroxyaurone 6-glucoside
PubChem CID: 131751385
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | CHEBI:142242, (Z)-4',6-Dihydroxyaurone 6-glucoside |
|---|---|
| Topological Polar Surface Area | 146.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | GVRZCIYFKOQSQL-CHHVJCJISA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | (Z)-4',6-Dihydroxyaurone 6-glucoside, (Z)-4',6-Dihydroxyaurone 6-O-b-D-glucopyranoside, (Z)-4',6-Dihydroxyaurone 6-O-b-D-glucoside, Hispidol 6-glucoside |
| Heavy Atom Count | 30.0 |
| Compound Name | (Z)-4',6-Dihydroxyaurone 6-glucoside |
| Description | Isolated from seedlings of Glycine max (soybean). (Z)-4',6-Dihydroxyaurone 6-glucoside is found in soy bean and pulses. |
| Exact Mass | 416.111 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 416.111 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 644.0 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 416.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2Z)-2-[(4-hydroxyphenyl)methylidene]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzofuran-3-one |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C21H20O9/c22-9-16-18(25)19(26)20(27)21(30-16)28-12-5-6-13-14(8-12)29-15(17(13)24)7-10-1-3-11(23)4-2-10/h1-8,16,18-23,25-27H,9H2/b15-7- |
| Smiles | C1=CC(=CC=C1/C=C\2/C(=O)C3=C(O2)C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
| Xlogp | 1.1 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C21H20O9 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all