Occidentoside
PubChem CID: 131751052
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Occidentoside, 2-[4-[3-b-D-Glucopyranosyl-2,4,6-trihydroxy-5-[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]phenoxy]phenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one, 9CI |
|---|---|
| Topological Polar Surface Area | 264.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Inchi Key | QAYDNOZSJGIPSH-XCVCLJGOSA-N |
| Rotatable Bond Count | 8.0 |
| State | Solid |
| Synonyms | 2-[4-[3-b-D-Glucopyranosyl-2,4,6-trihydroxy-5-[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]phenoxy]phenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one, 9CI, 2-[4-[3-b-D-Glucopyranosyl-2,4,6-trihydroxy-5-[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]phenoxy]phenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one, 9ci |
| Heavy Atom Count | 51.0 |
| Compound Name | Occidentoside |
| Kingdom | Organic compounds |
| Description | Isolated from Anacardium occidentale (cashew). Occidentoside is found in cashew nut and nuts. |
| Exact Mass | 704.174 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 704.174 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1220.0 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 704.6 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,7-dihydroxy-2-[4-[2,4,6-trihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenoxy]phenyl]-2,3-dihydrochromen-4-one |
| Total Atom Stereocenter Count | 6.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 1.0 |
| Class | Lignan glycosides |
| Inchi | InChI=1S/C36H32O15/c37-14-25-29(43)33(47)34(48)35(51-25)28-30(44)27(20(40)10-3-15-1-6-17(38)7-2-15)31(45)36(32(28)46)49-19-8-4-16(5-9-19)23-13-22(42)26-21(41)11-18(39)12-24(26)50-23/h1-12,23,25,29,33-35,37-39,41,43-48H,13-14H2/b10-3+ |
| Smiles | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)OC4=C(C(=C(C(=C4O)C(=O)/C=C/C5=CC=C(C=C5)O)O)C6C(C(C(C(O6)CO)O)O)O)O |
| Xlogp | 2.7 |
| Superclass | Lignans, neolignans and related compounds |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Lignan glycosides |
| Molecular Formula | C36H32O15 |
- 1. Outgoing r'ship
FOUND_INto/from Anacardium Occidentale (Plant) Rel Props:Source_db:fooddb_chem_all