24-Methylcholesta-5,7-dien-3-beta-ol
PubChem CID: 131750967
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5,7-Ergostadien-3beta -ol, Ergosta-5,7-dien-3beta -ol, laquo deltaRaquo 5,7-Ergostadienol, 24-Methylcholesta-5,7-dien-3beta-ol, 24-Methylcholesta-5,7-dien-3-beta -ol, 24S-Methylcholesta-5,7-dien-3beta -ol, laquo deltaRaquo 5,7-Ergostadien-3beta -ol |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | LATVVKIIEPSSHS-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | «, DELTA», 5,7-Ergostadien-3&beta, -ol, «, delta», 5,7-Ergostadienol, 22,23-Dihydroergosterol, 22,23-Dihydroergosterol, non-irradiated, 24-Methylcholesta-5,7-dien-3-&beta, -ol, 24-Methylcholesta-5,7-dien-3-beta -ol, 24-Methylcholesta-5,7-dien-3beta-ol, 24S-Methylcholesta-5,7-dien-3&beta, -ol, 24S-Methylcholesta-5,7-dien-3beta -ol, 5,7-Ergostadien-3&beta, -ol, 5,7-Ergostadien-3beta -ol, 5,7-Ergostadienol, Dihydroergosterol, Ergosta-5,7-dien-3-ol, Ergosta-5,7-dien-3&beta, -ol, Ergosta-5,7-dien-3beta -ol, Ergosta-5,7-dien-3beta-ol, Laquo deltaraquo 5,7-ergostadien-3beta -ol, Laquo deltaraquo 5,7-ergostadienol, Provitamin D4, Provitamin D7 |
| Heavy Atom Count | 29.0 |
| Compound Name | 24-Methylcholesta-5,7-dien-3-beta-ol |
| Kingdom | Organic compounds |
| Description | Constituent of seed oil of Vitis vinifera (wine grape). 22,23-Dihydroergosterol is found in many foods, some of which are common wheat, fruits, alcoholic beverages, and common mushroom. |
| Exact Mass | 398.355 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 398.355 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 672.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 398.7 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 17-(4,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Class | Steroids and steroid derivatives |
| Inchi | InChI=1S/C28H46O/c1-18(2)15-19(3)16-20(4)24-9-10-25-23-8-7-21-17-22(29)11-13-27(21,5)26(23)12-14-28(24,25)6/h7-8,18-20,22,24-26,29H,9-17H2,1-6H3 |
| Smiles | CC(C)CC(C)CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
| Xlogp | 8.2 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Cholestane steroids |
| Taxonomy Direct Parent | Cholesterols and derivatives |
| Molecular Formula | C28H46O |
- 1. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:fooddb_chem_all