Neryl rhamnosyl-glucoside
PubChem CID: 131750856
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Neryl rhamnosyl-glucoside, CHEBI:169082, 2-[[6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| Topological Polar Surface Area | 158.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | YZJBMONDZNACEV-WQLSENKSSA-N |
| Rotatable Bond Count | 9.0 |
| Synonyms | (2E)-3,7-Dimethyl-2,6-octadien-1-ol O-[a-L-rhamnopyranosyl-(1->6)-b-D-glucopyranoside], (2E)-3,7-Dimethyl-2,6-octadien-1-ol O-[a-L-rhamnosyl-(1->6)-b-D-glucoside], Geraniol rhamnosyl-glucoside, Geranyl rhamnosyl-glucoside |
| Heavy Atom Count | 32.0 |
| Compound Name | Neryl rhamnosyl-glucoside |
| Description | Constituent of wine grapes (Vitis vinifera). Geranyl rhamnosyl-glucoside is found in alcoholic beverages, fruits, and common grape. |
| Exact Mass | 462.246 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 462.246 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 634.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 462.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[[6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-methyloxane-3,4,5-triol |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C22H38O10/c1-11(2)6-5-7-12(3)8-9-29-21-20(28)18(26)16(24)14(32-21)10-30-22-19(27)17(25)15(23)13(4)31-22/h6,8,13-28H,5,7,9-10H2,1-4H3/b12-8- |
| Smiles | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC/C=C(/C)\CCC=C(C)C)O)O)O)O)O)O |
| Xlogp | -0.3 |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C22H38O10 |
- 1. Outgoing r'ship
FOUND_INto/from Vitis Vinifera (Plant) Rel Props:Source_db:fooddb_chem_all