Magnesium
PubChem CID: 13014144
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Magnesium tartrate, 20752-56-1, magnesium, 2,3-dihydroxybutanedioate, EINECS 244-008-4, SCHEMBL187380, NS00084843, A936532 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 121.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | True |
| Deep Smiles | OCCC=O)[O-]))O))C=O)[O-].[Mg+2] |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Hydroxy acids and derivatives |
| Classyfire Subclass | Beta hydroxy acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 123.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | magnesium, 2,3-dihydroxybutanedioate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H4MgO6 |
| Inchi Key | MUZDLCBWNVUYIR-UHFFFAOYSA-L |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | magnesium-tartrate |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)[O-], CO, [Mg+2] |
| Compound Name | Magnesium, 2,3-dihydroxybutanedioate |
| Exact Mass | 171.986 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 171.986 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 172.38 |
| Gi Absorption | False |
| Covalent Unit Count | 2.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C4H6O6.Mg/c5-1(3(7)8)2(6)4(9)10, /h1-2,5-6H,(H,7,8)(H,9,10), /q, +2/p-2 |
| Smiles | C(C(C(=O)[O-])O)(C(=O)[O-])O.[Mg+2] |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids, Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Viola Tricolor (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279