Selenomethylselenomethionine
PubChem CID: 129845685
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | selenomethylselenomethionine |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 88.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Aminoacids |
| Deep Smiles | CSCCCC=O)O))[Se]CC=[Se]))))N |
| Heavy Atom Count | 13.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 191.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-4-methylsulfanyl-2-(2-selanylideneethylselanyl)butanoic acid |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H13NO2SSe2 |
| Inchi Key | PVJVBAMTBGATBU-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 7.0 |
| Synonyms | seleno-methyl-seleno methionine |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)O, CC=[Se], CN, CSC, C[Se]C |
| Compound Name | Selenomethylselenomethionine |
| Exact Mass | 334.9 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 334.9 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 333.2 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C7H13NO2SSe2/c1-11-3-2-7(8,6(9)10)13-5-4-12/h4H,2-3,5,8H2,1H3,(H,9,10) |
| Smiles | CSCCC(C(=O)O)(N)[Se]CC=[Se] |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Reference:ISBN:9780896038776