2,3,4,6-Tetramethyl-d-galactose
PubChem CID: 129629182
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,3,4,6-tetramethyl-d-galactose |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 118.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Deep Smiles | [2H]CC[C@H][C@][C@][C@@]C=O))C[2H]))O))C[2H]))O))C[2H]))O))O))O |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 4.0 |
| Molecular Complexity | 270.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2R,3S,4S,5R)-7-deuterio-2,3,4-tris(deuteriomethyl)-2,3,4,5,6-pentahydroxyheptanal |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -2.4 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H20O6 |
| Inchi Key | DSAKBVMOWYDGMT-MYCDJTNXSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2,3,4,6-tetramethyl-d-galactose |
| Esol Class | Highly soluble |
| Functional Groups | CC=O, CO |
| Compound Name | 2,3,4,6-Tetramethyl-d-galactose |
| Exact Mass | 240.151 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 240.151 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 240.29 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H20O6/c1-6(12)7(13)9(3,15)10(4,16)8(2,14)5-11/h5-7,12-16H,1-4H3/t6?,7-,8+,9+,10-/m1/s1/i1D,2D,3D,4D |
| Smiles | [2H]CC([C@H]([C@@](C[2H])([C@@](C[2H])([C@](C[2H])(C=O)O)O)O)O)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Albizia Procera (Plant) Rel Props:Reference:ISBN:9770972795006