Schottenol 3-glucoside
PubChem CID: 12960489
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Schottenol 3-glucoside, beta-D-Glucopyranoside, (3beta,5alpha)-stigmast-7-en-3-yl |
|---|---|
| Topological Polar Surface Area | 99.4 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 41.0 |
| Description | Constituent of citron-melon fruits (Citrullus lanatus variety citroides). Schottenol 3-glucoside is found in watermelon, fruits, and spinach. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 920.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Nih Violation | False |
| Class | Steroids and steroid derivatives |
| Xlogp | 7.5 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Stigmastanes and derivatives |
| Molecular Formula | C35H60O6 |
| Inchi Key | XWPUVGRUJWXYTP-UHFFFAOYSA-N |
| Rotatable Bond Count | 9.0 |
| Synonyms | (3b,5a,24R)-Stigmast-7-en-3-ol 3-glucoside, (3b,5a,24R)-Stigmast-7-en-3-ol 3-O-b-D-glucopyranoside, (3b,5a,24R)-Stigmast-7-en-3-ol 3-O-b-D-glucoside, beta-D-Glucopyranoside, (3beta,5alpha)-stigmast-7-en-3-yl, Schottenol 3-glucoside, Schottenol beta-D-glucoside, Schottenol glucoside, Schottenol glucoside, (3beta)-isomer |
| Compound Name | Schottenol 3-glucoside |
| Kingdom | Organic compounds |
| Exact Mass | 576.439 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 576.439 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 576.8 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 14.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Inchi | InChI=1S/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h11,20-24,26-33,36-39H,7-10,12-19H2,1-6H3 |
| Smiles | CCC(CCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)C(C)C |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Stigmastanes and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Citrullus Lanatus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Spinacia Oleracea (Plant) Rel Props:Source_db:fooddb_chem_all