Campesterol glucoside
PubChem CID: 12895785
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ST 28:1, O, Hex, Campesterol glucoside, SCHEMBL15071420 |
|---|---|
| Topological Polar Surface Area | 99.4 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | FWNZEKQVBDXWKA-UHFFFAOYSA-N |
| Rotatable Bond Count | 8.0 |
| Synonyms | (3b,24R)-Ergost-5-en-3-ol O-b-D-glucopyranoside, Campesterol glucoside, Campesterol O-b-D-glucopyranoside, Campesterol O-b-D-glucoside |
| Heavy Atom Count | 40.0 |
| Compound Name | Campesterol glucoside |
| Kingdom | Organic compounds |
| Description | Campesterol glucoside is a member of the class of compounds known as steroidal glycosides. Steroidal glycosides are sterol lipids containing a carbohydrate moiety glycosidically linked to the steroid skeleton. Campesterol glucoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Campesterol glucoside can be found in cloves, common wheat, and peach, which makes campesterol glucoside a potential biomarker for the consumption of these food products. |
| Exact Mass | 562.423 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 562.423 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 905.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 562.8 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[[17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 14.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Steroids and steroid derivatives |
| Inchi | InChI=1S/C34H58O6/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-22-17-23(13-15-33(22,5)27(24)14-16-34(25,26)6)39-32-31(38)30(37)29(36)28(18-35)40-32/h9,19-21,23-32,35-38H,7-8,10-18H2,1-6H3 |
| Smiles | CC(C)C(C)CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C |
| Xlogp | 7.2 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Steroidal glycosides |
| Taxonomy Direct Parent | Steroidal glycosides |
| Molecular Formula | C34H58O6 |
- 1. Outgoing r'ship
FOUND_INto/from Prunus Persica (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Syzygium Aromaticum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:fooddb_chem_all