N~2~-Succinylornithine
PubChem CID: 127370
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N2-Succinyl-L-ornithine, N~2~-SUCCINYLORNITHINE, N(2)-succinyl-L-ornithine, N~2~-(3-CARBOXYPROPANOYL)-L-ORNITHINE, 99590-80-4, SUO, (2S)-5-Amino-2-(3-carboxypropanoylamino)pentanoic acid, N(2)-Succinylornithine, SCHEMBL1533875, CHEBI:27574, DTXSID40912618, DB03582, N(2)-(3-carboxypropanoyl)-L-ornithine, NS00068527, C03415, N~2~-(3-Carboxy-1-hydroxypropylidene)ornithine, (2S)-5-amino-2-(3-carboxypropanamido)pentanoic acid, Q27103203 |
|---|---|
| Topological Polar Surface Area | 130.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 16.0 |
| Description | N2-Succinyl-L-ornithine is a substrate for Ornithine aminotransferase (mitochondrial). [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 267.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-5-amino-2-(3-carboxypropanoylamino)pentanoic acid |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -3.9 |
| Superclass | Organic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C9H16N2O5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | VWXQFHJBQHTHMK-LURJTMIESA-N |
| Fcsp3 | 0.6666666666666666 |
| Logs | -0.902 |
| Rotatable Bond Count | 8.0 |
| State | Solid |
| Logd | -1.402 |
| Synonyms | (2S)-5-amino-2-(3-Carboxypropanoylamino)pentanoate, (2S)-5-amino-2-(3-Carboxypropanoylamino)pentanoic acid, N2-Succinyl-L-ornithine |
| Substituent Name | N-acyl-aliphatic-alpha amino acid, N-acyl-l-alpha-amino acid, Amino fatty acid, Fatty acyl, Fatty acid, N-acyl-amine, Fatty amide, Dicarboxylic acid or derivatives, Secondary carboxylic acid amide, Carboxamide group, Carboxylic acid, Carboxylic acid amide, Hydrocarbon derivative, Primary amine, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Carbonyl group, Amine, Aliphatic acyclic compound |
| Compound Name | N~2~-Succinylornithine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 232.106 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 232.106 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 232.23 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.3775368000000003 |
| Inchi | InChI=1S/C9H16N2O5/c10-5-1-2-6(9(15)16)11-7(12)3-4-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/t6-/m0/s1 |
| Smiles | C(C[C@@H](C(=O)O)NC(=O)CCC(=O)O)CN |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Adonis Amurensis (Plant) Rel Props:Source_db:cmaup_ingredients