Perillic acid
PubChem CID: 1256
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Perillic acid, 7694-45-3, (-)-perillic acid, Perillicacid, 4-Isopropenylcyclohex-1-enecarboxylic acid, 4-prop-1-en-2-ylcyclohexene-1-carboxylic acid, PKS69DU4ZQ, 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid, 1-Cyclohexene-1-carboxylicacid, 4-(1-methylethenyl)-, CHEBI:36999, 4-Isopropenyl-1-cyclohexene-1-carboxylic acid, 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid, 1-Cyclohexene-1-carboxylic acid, 4-(1-methylethenyl)-, SR-01000076076, EINECS 231-709-5, 4-isopropenylcyclohex-1-ene carboxylic acid, 4-(2-propenyl)-1-cyclohexane-1-carboxylic acid, UNII-PKS69DU4ZQ, Lopac0_001001, SCHEMBL465998, CHEMBL1373981, DTXSID60864105, HMS3263I03, Tox21_501001, NSC641067, AKOS006230667, CCG-205081, LMPR0102090041, LP01001, NSC-641067, SDCCGSBI-0050974.P002, NCGC00015832-02, NCGC00015832-03, NCGC00015832-04, NCGC00015832-05, NCGC00015832-06, NCGC00015832-07, NCGC00094295-01, NCGC00094295-02, NCGC00094295-03, NCGC00094295-04, NCGC00261686-01, NCI60_013759, SY316382, HY-113471, CS-0062325, EU-0101001, NS00015181, P 7083, SR-01000076076-1, SR-01000076076-5, SR-01000076076-6, (S)-4-(1-Propen-2-yl)cyclohex-1-enecarboxylic Acid, Q27104388, 1A4758DA-6365-4FD5-BAEA-16032D3488FF |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Menthane monoterpenoids |
| Deep Smiles | CC=C)CCCC=CC6))C=O)O |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Prenol lipids |
| Description | Perillic acid is an intermediate in the Limonene and pinene degradation pathway. (KEGG), Its measurement in urine is used to monitor cancer patients receiving oral Limonene (a farnesyl transferase inhibitor that has shown antitumor properties)(PubMed ID 8723738 ). Perillic acid is found in cardamom. |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 238.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P49189, P49419, P47895, P05091, P51648, P30837, P02545, Q194T2, O89049, O94782, P15289 |
| Iupac Name | 4-prop-1-en-2-ylcyclohexene-1-carboxylic acid |
| Nih Violation | False |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.7 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Monoterpenoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H14O2 |
| Scaffold Graph Node Bond Level | C1=CCCCC1 |
| Inchi Key | CDSMSBUVCWHORP-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Synonyms | (-)-perillic acid, (+-)-Perrillic acid, (S)-(-)-4-Isopropenyl-1-cyclohexene-1-carboxylic acid, 1-Cyclohexene-1-carboxylic acid, 4-(1-methylethenyl)-, 4-(1-Methylethenyl)-1-cyclohexene-1-carboxylate, 4-(1-methylethenyl)-1-cyclohexene-1-carboxylic acid, 4-(2-propenyl)-1-cyclohexane-1-carboxylic acid, 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carboxylic acid, 4-Isopropenyl-1-cyclohexene-1-carboxylic acid, 4-isopropenylcyclohex-1-ene carboxylic acid, 4-Isopropenylcyclohex-1-enecarboxylate, 4-Isopropenylcyclohex-1-enecarboxylic acid, p-Mentha-1,8-dien-7-oic acid, Perillate, Perillic acid, 4-(1-Methylethenyl)-1-cyclohexene-1-carboxylic acid, 4-(2-Propenyl)-1-cyclohexane-1-carboxylic acid, 4-Isopropenylcyclohex-1-ene carboxylic acid, perillic acid |
| Substituent Name | Menthane monoterpenoid, Monocyclic monoterpenoid, Monocarboxylic acid or derivatives, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic homomonocyclic compound |
| Esol Class | Soluble |
| Functional Groups | C=C(C)C, CC=C(C)C(=O)O |
| Compound Name | Perillic acid |
| Kingdom | Organic compounds |
| Exact Mass | 166.099 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 166.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 166.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H14O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h5,8H,1,3-4,6H2,2H3,(H,11,12) |
| Smiles | CC(=C)C1CCC(=CC1)C(=O)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Menthane monoterpenoids |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1996.9701025 - 2. Outgoing r'ship
FOUND_INto/from Elettaria Cardamomum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Perilla Frutescens (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/22272932