Beta-D-Xylopyranose
PubChem CID: 125409
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | BETA-D-XYLOPYRANOSE, beta-D-Xylose, beta-D Xylose, 2460-44-8, (2R,3R,4S,5R)-oxane-2,3,4,5-tetrol, UNII-0122W3SP9U, CHEBI:28161, 0122W3SP9U, DTXSID20179348, (2-CYANOETHOXY)-2-(2''-O-1,1''-DIMETHOXYTRITYLOXYETHYLSULFONYL)- ETHOXY-N,N-DIISOPROPYLAMINOPHOS, beta-Xylopyranose, XYP, .beta.-D-Xylopyranose, beta-D-Xyl, 1,4beta-D-xylan, 1,4-beta-D-Xylan, .BETA.-D-XYLOSE, (1,4-beta-D-Xylan)n, Epitope ID:167188, (1->4)-beta-D-xylan, XYLOPYRANOSE, beta-D-, (1->4)-beta-D-xylopyranan, SCHEMBL624301, CHEBI:15447, DTXCID50101839, 9014-63-5, C02096, E82640, Q27103537, (2R,3R,4S,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetraol, WURCS=2.0/1,1,0/(a212h-1b_1-5)/1/ |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | O[C@@H]CO[C@H][C@@H][C@H]6O))O))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Description | β-d-xylopyranose, also known as &beta, -D-xylose, is a member of the class of compounds known as pentoses. Pentoses are monosaccharides in which the carbohydrate moiety contains five carbon atoms. β-d-xylopyranose is very soluble (in water) and a very weakly acidic compound (based on its pKa). β-d-xylopyranose can be found in a number of food items such as colorado pinyon, flaxseed, star anise, and dandelion, which makes β-d-xylopyranose a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | fooddb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2R,3R,4S,5R)-oxane-2,3,4,5-tetrol |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.5 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10O5 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Inchi Key | SRBFZHDQGSBBOR-KKQCNMDGSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | d-xylose |
| Esol Class | Highly soluble |
| Functional Groups | CO, CO[C@H](C)O |
| Compound Name | Beta-D-Xylopyranose |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5-/m1/s1 |
| Smiles | C1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Auriculiformis (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172362089 - 2. Outgoing r'ship
FOUND_INto/from Althaea Officinalis (Plant) Rel Props:Reference:ISBN:9788185042084 - 3. Outgoing r'ship
FOUND_INto/from Anacardium Occidentale (Plant) Rel Props:Reference:ISBN:9770972795006 - 4. Outgoing r'ship
FOUND_INto/from Anogeissus Latifolia (Plant) Rel Props:Reference:ISBN:9788172360818 - 5. Outgoing r'ship
FOUND_INto/from Brasenia Schreberi (Plant) Rel Props:Reference:ISBN:9788172362089 - 6. Outgoing r'ship
FOUND_INto/from Cestrum Nocturnum (Plant) Rel Props:Reference:ISBN:9788172362089 - 7. Outgoing r'ship
FOUND_INto/from Cordia Dichotoma (Plant) Rel Props:Reference:ISBN:9788172361150 - 8. Outgoing r'ship
FOUND_INto/from Cordia Sinensis (Plant) Rel Props:Reference:ISBN:9770972795006 - 9. Outgoing r'ship
FOUND_INto/from Ginkgo Biloba (Plant) Rel Props:Reference:ISBN:9788172362300 - 10. Outgoing r'ship
FOUND_INto/from Lagenaria Siceraria (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/18054349 - 11. Outgoing r'ship
FOUND_INto/from Madhuca Longifolia (Plant) Rel Props:Reference:ISBN:9788172361150 - 12. Outgoing r'ship
FOUND_INto/from Manilkara Zapota (Plant) Rel Props:Reference:ISBN:9788172361150 - 13. Outgoing r'ship
FOUND_INto/from Mimosa Pudica (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 14. Outgoing r'ship
FOUND_INto/from Mimusops Elengi (Plant) Rel Props:Reference:ISBN:9788172361150 - 15. Outgoing r'ship
FOUND_INto/from Nymphaea Nouchali (Plant) Rel Props:Reference:ISBN:9788172362461 - 16. Outgoing r'ship
FOUND_INto/from Plantago Asiatica (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 17. Outgoing r'ship
FOUND_INto/from Plantago Ovata (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 18. Outgoing r'ship
FOUND_INto/from Sansevieria Trifasciata (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 19. Outgoing r'ship
FOUND_INto/from Senna Multijuga (Plant) Rel Props:Reference:ISBN:9788185042114 - 20. Outgoing r'ship
FOUND_INto/from Solanum Americanum (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 21. Outgoing r'ship
FOUND_INto/from Tamarindus Indica (Plant) Rel Props:Reference:ISBN:9780387706375 - 22. Outgoing r'ship
FOUND_INto/from Terminalia Alata (Plant) Rel Props:Reference:ISBN:9788172360818 - 23. Outgoing r'ship
FOUND_INto/from Vallisneria Spiralis (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788172362140 - 24. Outgoing r'ship
FOUND_INto/from Vigna Radiata (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/13385245