(3S,3aR,4aS,5S,8aR,9aR)-3,5,8a-trimethyl-3,3a,4,4a,5,6,7,8,9,9a-decahydrobenzo[f][1]benzofuran-2-one
PubChem CID: 12443346
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | True |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC2CC3CCCCC3CC2C1 |
| Np Classifier Class | Eudesmane sesquiterpenoids |
| Deep Smiles | C[C@@H]C=O)O[C@H][C@@H]5C[C@H][C@@H]C)CCC[C@@]6C%10)C |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CC2CC3CCCCC3CC2O1 |
| Classyfire Subclass | Terpene lactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 338.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (3S,3aR,4aS,5S,8aR,9aR)-3,5,8a-trimethyl-3,3a,4,4a,5,6,7,8,9,9a-decahydrobenzo[f][1]benzofuran-2-one |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 4.3 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H24O2 |
| Scaffold Graph Node Bond Level | O=C1CC2CC3CCCCC3CC2O1 |
| Inchi Key | YFENNIONFLKMQN-GGZSWOCBSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | tetrahydroalantolactone |
| Esol Class | Moderately soluble |
| Functional Groups | CC(=O)OC |
| Compound Name | (3S,3aR,4aS,5S,8aR,9aR)-3,5,8a-trimethyl-3,3a,4,4a,5,6,7,8,9,9a-decahydrobenzo[f][1]benzofuran-2-one |
| Exact Mass | 236.178 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 236.178 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 236.35 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H24O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h9-13H,4-8H2,1-3H3/t9-,10-,11+,12-,13+,15+/m0/s1 |
| Smiles | C[C@H]1CCC[C@]2([C@H]1C[C@@H]3[C@@H](C(=O)O[C@@H]3C2)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Inula Racemosa (Plant) Rel Props:Reference:ISBN:9788171360536