[(1R,2R,6S,7S,8R,10S,11S,12R,14R,16S,17R,18R)-6,7-Dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-5-oxo-14-phenyl-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate
PubChem CID: 124210
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Genkwadaphnin, 55073-32-0, [(1R,2R,6S,7S,8R,10S,11S,12R,14R,16S,17R,18R)-6,7-Dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-5-oxo-14-phenyl-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate, 12-beta-(Benzoyloxy)daphnetoxin, BRN 1675425, Daphnetoxin, 12-(benzoyloxy)-, (12beta)-, Daphnetoxin, 12-(benzoyloxy)-, (12-beta)-, DTXSID10970422, DA-73696, 5,5a-Dihydroxy-4a-(hydroxymethyl)-7,9-dimethyl-6-oxo-2-phenyl-10a-(prop-1-en-2-yl)-3a,3c,4a,5,5a,6,8a,9,10,10a-decahydro-2H,3bH-2,8b-epoxyoxireno[6,7]azuleno[5,4-e][1,3]benzodioxol-10-yl benzoate |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 144.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CC1CC23CC4(C5CCCCC5)CC1C(C4)C2C1CC1CC1C(C)CCC13)C1CCCCC1 |
| Np Classifier Class | Daphnane diterpenoids |
| Deep Smiles | OC[C@]O[C@H]3[C@H][C@H]O[C@@]O[C@]6[C@H][C@@][C@@H]%12O))O)C=O)C=C5)C)))))[C@@H][C@H][C@@]8O7)C=C)C)))OC=O)cccccc6)))))))))C))))cccccc6 |
| Heavy Atom Count | 44.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCC2C1CC1OC1C1C3OC4(C5CCCCC5)OC3C(OC(O)C3CCCCC3)CC21O4 |
| Classyfire Subclass | Diterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1320.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 12.0 |
| Iupac Name | [(1R,2R,6S,7S,8R,10S,11S,12R,14R,16S,17R,18R)-6,7-dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-5-oxo-14-phenyl-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.7 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C34H34O10 |
| Scaffold Graph Node Bond Level | O=C(OC1CC23OC4(c5ccccc5)OC1C(O4)C2C1OC1CC1C(=O)C=CC13)c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | QKMXESBAFIKRAD-LPHDITAFSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.4705882352941176 |
| Logs | -3.892 |
| Rotatable Bond Count | 6.0 |
| Logd | 2.574 |
| Synonyms | genkwadaphnin |
| Esol Class | Moderately soluble |
| Functional Groups | C=C(C)C, CC1=CCCC1=O, CO, C[C@]1(C)O[C@H]1C, cC(=O)OC, c[C@@]1(OC)OCCO1 |
| Compound Name | [(1R,2R,6S,7S,8R,10S,11S,12R,14R,16S,17R,18R)-6,7-Dihydroxy-8-(hydroxymethyl)-4,18-dimethyl-5-oxo-14-phenyl-16-prop-1-en-2-yl-9,13,15,19-tetraoxahexacyclo[12.4.1.01,11.02,6.08,10.012,16]nonadec-3-en-17-yl] benzoate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 602.215 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 602.215 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 602.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 12.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -5.108361381818184 |
| Inchi | InChI=1S/C34H34O10/c1-17(2)32-25(40-28(37)20-11-7-5-8-12-20)19(4)33-22-15-18(3)24(36)31(22,39)29(38)30(16-35)26(41-30)23(33)27(32)42-34(43-32,44-33)21-13-9-6-10-14-21/h5-15,19,22-23,25-27,29,35,38-39H,1,16H2,2-4H3/t19-,22-,23+,25-,26+,27-,29-,30+,31-,32+,33+,34+/m1/s1 |
| Smiles | C[C@@H]1[C@H]([C@]2([C@H]3[C@H]4[C@]1([C@@H]5C=C(C(=O)[C@]5([C@@H]([C@@]6([C@H]4O6)CO)O)O)C)O[C@@](O3)(O2)C7=CC=CC=C7)C(=C)C)OC(=O)C8=CC=CC=C8 |
| Nring | 8.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Daphne Arisanensis (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Daphne Aurantiaca (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Daphne Bholua (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Daphne Blagayana (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Daphne Feddei (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Daphne Genkwa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Daphne Giraldii (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Daphne Gnidium (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Daphne Lancifolia (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Daphne Mezereum (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Daphne Mucronata (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Daphne Odora (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Daphne Oleoides (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/11292319 - 14. Outgoing r'ship
FOUND_INto/from Daphne Papyracea (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Daphne Retusa (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Daphne Tangutica (Plant) Rel Props:Reference: