14-Oxoheptacosanoic acid
PubChem CID: 123768270
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 14-oxoheptacosanoic acid |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 54.4 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Oxo fatty acids |
| Deep Smiles | CCCCCCCCCCCCCC=O)CCCCCCCCCCCCC=O)O |
| Heavy Atom Count | 30.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 378.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 14-oxoheptacosanoic acid |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 9.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C27H52O3 |
| Inchi Key | OWCQOYUMRDGWNL-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 25.0 |
| Synonyms | 14-oxo-heptacosanoic acid, 14-oxoheptacosanoic acid |
| Esol Class | Poorly soluble |
| Functional Groups | CC(=O)O, CC(C)=O |
| Compound Name | 14-Oxoheptacosanoic acid |
| Exact Mass | 424.392 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 424.392 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 424.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C27H52O3/c1-2-3-4-5-6-7-8-11-14-17-20-23-26(28)24-21-18-15-12-9-10-13-16-19-22-25-27(29)30/h2-25H2,1H3,(H,29,30) |
| Smiles | CCCCCCCCCCCCCC(=O)CCCCCCCCCCCCC(=O)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty Acids and Conjugates |
- 1. Outgoing r'ship
FOUND_INto/from Cheilocostus Speciosus (Plant) Rel Props:Reference:ISBN:9788172362140