Gibberellin A23
PubChem CID: 12310189
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gibberellin A23 |
|---|---|
| Topological Polar Surface Area | 132.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | HRIAGYDCQBIJJM-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | GA23, Gibberellin A23, Lupinus gibberellin II |
| Heavy Atom Count | 27.0 |
| Compound Name | Gibberellin A23 |
| Description | Gibberellin a23 is a member of the class of compounds known as c20-gibberellin 6-carboxylic acids. C20-gibberellin 6-carboxylic acids are c20-gibberellins with a carboxyl group at the 6-position. Gibberellin a23 is slightly soluble (in water) and a weakly acidic compound (based on its pKa). Gibberellin a23 can be found in sweet potato, which makes gibberellin a23 a potential biomarker for the consumption of this food product. |
| Exact Mass | 378.168 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 378.168 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 761.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 378.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 8-formyl-5,12-dihydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C20H26O7/c1-10-7-19-8-20(10,27)6-3-11(19)18(9-21)5-4-12(22)17(2,16(25)26)14(18)13(19)15(23)24/h9,11-14,22,27H,1,3-8H2,2H3,(H,23,24)(H,25,26) |
| Smiles | CC1(C(CCC2(C1C(C34C2CCC(C3)(C(=C)C4)O)C(=O)O)C=O)O)C(=O)O |
| Xlogp | 0.1 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H26O7 |
- 1. Outgoing r'ship
FOUND_INto/from Ipomoea Batatas (Plant) Rel Props:Source_db:fooddb_chem_all