(S)-Bilobanone
PubChem CID: 12308753
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (S)-Bilobanone, Bilobanone, 17015-33-7, 2-METHYL-5-[5-(2-METHYLPROPYL)FURAN-3-YL]CYCLOHEX-2-EN-1-ONE, Bilobanon, 2-methyl-5-(5-(2-methylpropyl)furan-3-yl)cyclohex-2-en-1-one |
|---|---|
| Topological Polar Surface Area | 30.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 17.0 |
| Description | Constituent of Ginkgo biloba (ginhgo). (S)-Bilobanone is found in ginkgo nuts and fats and oils. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 317.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-methyl-5-[5-(2-methylpropyl)furan-3-yl]cyclohex-2-en-1-one |
| Nih Violation | False |
| Class | Organooxygen compounds |
| Xlogp | 3.4 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbonyl compounds |
| Molecular Formula | C15H20O2 |
| Inchi Key | ORQIZUYAGXZVPI-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | Bilobanon, Bilobanone |
| Compound Name | (S)-Bilobanone |
| Kingdom | Organic compounds |
| Exact Mass | 232.146 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 232.146 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 232.32 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Inchi | InChI=1S/C15H20O2/c1-10(2)6-14-7-13(9-17-14)12-5-4-11(3)15(16)8-12/h4,7,9-10,12H,5-6,8H2,1-3H3 |
| Smiles | CC1=CCC(CC1=O)C2=COC(=C2)CC(C)C |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Cyclohexenones |
- 1. Outgoing r'ship
FOUND_INto/from Ginkgo Biloba (Plant) Rel Props:Source_db:fooddb_chem_all