11-Deoxyglycyrrhetinic Acid
PubChem CID: 12305517
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 11-Deoxoglycyrrhetinic acid, 564-16-9, 11-Deoxo-18beta-glycyrrhetic acid, (2S,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid, 11-Deoxyglycyrrhetinic acid, 11-deoxy glycyrrhetinic acid, CHEMBL487933, 3alpha-hydroxyolean-12-en-30-oic acid, (2S,4aS,6aS,6bR,8aR,10S,12aR,12bR,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2-carboxylic acid, 11-Deoxoglycyrrhetic acid, Anaphalisoleanenoic acid, 11-Desoxoglycyrrhetinsaure, 11-DOGA, SCHEMBL1785482, CHEBI:168602, 11-Deoxo-18beta-glycyrrhetinic acid, ARD193990, BDBM50346605, LMPR0106150016, (3beta,20beta)-3-hydroxyolean-12-en-29-oic acid, Olean-12-en-30-oic acid, 3beta-hydroxy- (8CI), 3-Hydroxy-(3beta,20beta)-Olean-12-en-29-oic acid |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 57.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1C2CCC2C3CCCCC3CCC21 |
| Np Classifier Class | Oleanane triterpenoids |
| Deep Smiles | O[C@H]CC[C@][C@H]C6C)C))CC[C@@][C@@H]6CC=C[C@@]6C)CC[C@@][C@H]6C[C@]C)CC6))C=O)O)))))C)))))))))C)))))C |
| Heavy Atom Count | 33.0 |
| Classyfire Class | Prenol lipids |
| Description | Isolated from roots of Glycyrrhiza glabra (licorice). 11-Deoxoglycyrrhetinic acid is found in tea and herbs and spices. |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1C2CCC2C3CCCCC3CCC21 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 889.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 9.0 |
| Uniprot Id | P00489, P23141, O00748, Q16236, P09917, O15296, P05979, P35354 |
| Iupac Name | (2S,4aS,6aR,6aS,6bR,8aR,10S,12aR,14bR)-10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Target Id | NPT166, NPT203, NPT570 |
| Xlogp | 7.5 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Triterpenoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H48O3 |
| Scaffold Graph Node Bond Level | C1=C2C3CCCCC3CCC2C2CCC3CCCCC3C2C1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JZFSMVXQUWRSIW-BTJIZOSBSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.9 |
| Logs | -4.377 |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Logd | 4.994 |
| Synonyms | 11-Deoxo-18beta-glycyrrhetic acid, 11-Deoxo-18beta-glycyrrhetinic acid, 11-Deoxoglycyrrhetic acid, 11-Deoxoglycyrrhetinic acid, 3-Hydroxy-(3beta,20beta)-olean-12-en-29-Oic acid, Anaphalisoleanenoic acid, Olean-12-en-29-oic acid, 3-hydroxy-, (3beta,20beta)-, Olean-12-en-30-oic acid, 3beta-hydroxy- (8CI), 11-Deoxoglycyrrhetinate, 11-Deoxyglycyrrhetinic acid, 11-Deoxyglycyrrhetinate, 11-deoxo-18beta-Glycyrrhetic acid, 11-deoxo-18beta-Glycyrrhetinic acid, Olean-12-en-30-Oic acid, 3beta-hydroxy- (8ci), 11-Deoxy glycyrrhetinic acid, 11-DOGA, 11-deoxoglycyrrhetic, 11-deoxoglycyrrhetic acid, 11-desoxoglycyrrhetinic-acid, glycyrrhetic acid, 11-deoxo |
| Esol Class | Poorly soluble |
| Functional Groups | CC(=O)O, CC=C(C)C, CO |
| Compound Name | 11-Deoxyglycyrrhetinic Acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 456.36 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 456.36 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 456.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -7.324308200000002 |
| Inchi | InChI=1S/C30H48O3/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)31)9-8-19-20-18-27(4,24(32)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23-,26+,27-,28-,29+,30+/m0/s1 |
| Smiles | C[C@]12CC[C@](C[C@H]1C3=CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)(C)C(=O)O |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Triterpenoids |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Eucommia Ulmoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Glabra (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Glycyrrhiza Inflata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all