Episarsasapogenin
PubChem CID: 12304430
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Episarsasapogenin, epi-Sarsasapogenin, 470-03-1, (3alpha,5beta,25S)-Spirostan-3-ol, Spirostan-3-ol, (3alpha,5beta,25S)-, (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,16R,18R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-ol, 3-Episarsasapogenin, NSC 231816, (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,16R,18R)-5',7,9,13-tetramethylspiro(5-oxapentacyclo(10.8.0.02,9.04,8.013,18)icosane-6,2'-oxane)-16-ol, Spirostan-3-ol, (3.alpha.,5.beta.,25S)-, SCHEMBL15335261, GMBQZIIUCVWOCD-RHHRBMONSA-N, (25s)3alpha-hydroxy-5beta-spirostane |
|---|---|
| Topological Polar Surface Area | 38.7 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | GMBQZIIUCVWOCD-RHHRBMONSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | (25S)-5-beta-spirostan-3-alpha-ol, 3-Episarsasapogenin, Episarsasapogenin |
| Heavy Atom Count | 30.0 |
| Compound Name | Episarsasapogenin |
| Description | Episarsasapogenin, also known as smilagenin or sarsasapogenin, (3beta,5beta,25s)-isomer, is a member of the class of compounds known as triterpenoids. Triterpenoids are terpene molecules containing six isoprene units. Episarsasapogenin is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Episarsasapogenin can be found in fenugreek, which makes episarsasapogenin a potential biomarker for the consumption of this food product. |
| Exact Mass | 416.329 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 416.329 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 694.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 416.6 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 12.0 |
| Iupac Name | (1R,2S,4S,5'S,6R,7S,8R,9S,12S,13S,16R,18R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-ol |
| Total Atom Stereocenter Count | 12.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C27H44O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h16-24,28H,5-15H2,1-4H3/t16-,17-,18+,19+,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
| Smiles | C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC[C@H]6[C@@]5(CC[C@H](C6)O)C)C)C)OC1 |
| Xlogp | 6.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C27H44O3 |
- 1. Outgoing r'ship
FOUND_INto/from Trigonella Foenum-Graecum (Plant) Rel Props:Source_db:fooddb_chem_all