Alpha-Colubrine
PubChem CID: 12303796
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-COLUBRINE, 3-Methoxystrychnine, 509-44-4, 3-Methoxystrychnidin-10-one, UNII-42R57747MD, Strychnidin-10-one, 3-methoxy-, .ALPHA.-COLUBRINE, 42R57747MD, 11-METHOXYSTRYCHNINE, .ALPHA.-COLUBRINE [MI], CHEBI:132696, (4aR,5aS,8aR,13aS,15aS,15bR)-11-methoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one, DTXSID90965139, a-Colubrine, (4aR,5aS,8aR,13aS,15aS,15bR)-11-methoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo(3,2,1-ij)oxepino(2,3,4-de)pyrrolo(2,3-h)quinolin-14-one, (4aR,5aS,8aR,13aS,15aS,15bR)-11-methoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo(3,2,1-ij)oxepino(2,3,4-de)pyrrolo(2,3-h)quinoline-14-one, (4aR,5aS,8aR,13aS,15aS,15bR)-11-methoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-14-one, CHEMBL2164940, DTXCID001392816, Strychnidin-10-one, 3-methoxy-(9CI), Q27258568 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 42.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC2CCCC3CC4CCC56C4CC3C2C5C1C1CCCCC16 |
| Np Classifier Class | Aspidosperma-Iboga hybrid type (Vinca alkaloids), Strychnos type |
| Deep Smiles | COcccccc6)NC=O)C[C@H][C@H][C@H]6[C@]9CCN[C@H]5C[C@H]9C=CCO%14)))C6 |
| Heavy Atom Count | 27.0 |
| Classyfire Class | Strychnos alkaloids |
| Scaffold Graph Node Level | OC1CC2OCCC3CN4CCC56C7CCCCC7N1C5C2C3CC46 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 737.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | (4aR,5aS,8aR,13aS,15aS,15bR)-11-methoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 1.9 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C22H24N2O3 |
| Scaffold Graph Node Bond Level | O=C1CC2OCC=C3CN4CCC56c7ccccc7N1C5C2C3CC46 |
| Prediction Swissadme | 1.0 |
| Inchi Key | CAPUGADOGHKUQS-JPPAUQSISA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5909090909090909 |
| Logs | -3.374 |
| Rotatable Bond Count | 1.0 |
| Logd | 2.245 |
| Synonyms | alpha colubrine, alpha-colubrine, α-colubrine |
| Esol Class | Soluble |
| Functional Groups | CC=C(C)C, CN(C)C, COC, cN(C)C(C)=O, cOC |
| Compound Name | Alpha-Colubrine |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 364.179 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 364.179 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 364.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.3950034444444452 |
| Inchi | InChI=1S/C22H24N2O3/c1-26-13-2-3-15-16(8-13)24-19(25)10-17-20-14-9-18-22(15,21(20)24)5-6-23(18)11-12(14)4-7-27-17/h2-4,8,14,17-18,20-21H,5-7,9-11H2,1H3/t14-,17-,18-,20-,21-,22+/m0/s1 |
| Smiles | COC1=CC2=C(C=C1)[C@]34CCN5[C@H]3C[C@@H]6[C@@H]7[C@@H]4N2C(=O)C[C@@H]7OCC=C6C5 |
| Nring | 7.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Nux Vomica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Strychnos Aculeata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Strychnos Aenea (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Strychnos Afzelii (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Strychnos Amazonica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Strychnos Angustiflora (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Strychnos Camptoneura (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Strychnos Cathayensis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Strychnos Colubrina (Plant) Rel Props:Reference:ISBN:9788172363093 - 10. Outgoing r'ship
FOUND_INto/from Strychnos Decussata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Strychnos Diplotricha (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Strychnos Dolichothyrsa (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Strychnos Elaeocarpa (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Strychnos Erichsonii (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Strychnos Fendleri (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Strychnos Froesii (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Strychnos Gossweileri (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Strychnos Henningsii (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Strychnos Icaja (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Strychnos Ignatii (Plant) Rel Props:Reference:ISBN:9780387706375 - 21. Outgoing r'ship
FOUND_INto/from Strychnos Ledermannii (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Strychnos Ligustrina (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Strychnos Malaccensis (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Strychnos Minor (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Strychnos Nitida (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Strychnos Nux-Vomica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 27. Outgoing r'ship
FOUND_INto/from Strychnos Panamensis (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Strychnos Potatorum (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Strychnos Spinosa (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Strychnos Splendens (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Strychnos Staudtii (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Strychnos Tabascana (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Strychnos Tomentosa (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Strychnos Tricalysioides (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Strychnos Triplinervia (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Strychnos Usambarensis (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Strychnos Vanprukii (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Strychnos Wallichiana (Plant) Rel Props:Reference: