Isocephaeline
PubChem CID: 12302705
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Isocephaeline, Emetan-6'-ol, 7',10,11-trimethoxy-, (1'beta)-, 5884-45-7, DTXSID20207559, (1S)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol, 10-O-Demethylisocephaeline, CHEMBL486005, DTXCID20130050, BDBM50478866, CCG-35394 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 63.2 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCCC2CC1CCC2CCC3CCCCC3C2C1 |
| Np Classifier Class | Isoquinoline alkaloids, Terpenoid tetrahydroisoquinoline alkaloids |
| Deep Smiles | CC[C@H]CNCCcc[C@@H]6C[C@@H]%10C[C@@H]NCCcc6ccOC))cc6)O))))))))))))))cccc6)OC)))OC |
| Heavy Atom Count | 34.0 |
| Classyfire Class | Emetine alkaloids |
| Scaffold Graph Node Level | C1CCC2C(C1)CCNC2CC1CCN2CCC3CCCCC3C2C1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 664.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Uniprot Id | Q99814 |
| Iupac Name | (1S)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 4.4 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C28H38N2O4 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)CCNC2CC1CCN2CCc3ccccc3C2C1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | DTGZHCFJNDAHEN-IAUHIMIASA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.5714285714285714 |
| Logs | -2.527 |
| Rotatable Bond Count | 6.0 |
| Logd | 3.826 |
| Synonyms | isocephaeline |
| Esol Class | Moderately soluble |
| Functional Groups | CN(C)C, CNC, cO, cOC |
| Compound Name | Isocephaeline |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 466.283 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 466.283 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 466.6 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -5.376532870588236 |
| Inchi | InChI=1S/C28H38N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,23-24,29,31H,5-11,16H2,1-4H3/t17-,20-,23-,24-/m0/s1 |
| Smiles | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@H]4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Alangium Arckii (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Alangium Begonifolium (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Alangium Chinense (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Alangium Grisolleoides (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Alangium Hexapetalum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Alangium Kurzii (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Alangium Lamarckii (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Alangium Platanifolium (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Alangium Premnifolium (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Alangium Ridleyi (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Alangium Salviifolium (Plant) Rel Props:Source_db:npass_chem_all; Reference: - 12. Outgoing r'ship
FOUND_INto/from Psychotria Adenophylla (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Psychotria Bahiensis (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Psychotria Calocarpa (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Psychotria Dalzelii (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Psychotria Glandulosa (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Psychotria Klugii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Psychotria Leiocarpa (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Psychotria Platyneura (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Psychotria Rostrata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Psychotria Sarmentosa (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Psychotria Serpens (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Psychotria St (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Psychotria Stachyoides (Plant) Rel Props:Reference: