Bruceine D
PubChem CID: 122784
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Bruceine D, Brucein D, (1R,2R,3R,6R,8S,12S,13S,14R,15R,16S,17S)-2,3,12,15,16-pentahydroxy-9,13,17-trimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-4,11-dione, 21499-66-1, NSC 318801, Picras-3-ene-2,16-dione, 13,20-epoxy-1,11,12,14,15-pentahydroxy-, (1beta,11beta,12alpha,15beta)-, CHEMBL477693, 5H-3,11c-beta-(Epoxymethano)phenanthro(10,1-bc)pyran-5,10(6a-beta-H)-dione, 1,2,3,3a,4,7,7a-alpha,11,11a,11b-alpha-decahydro-1-beta,2-alpha,3a-beta,4-beta,11-beta-pentahydroxy-3-alpha,8,11a-beta-trimethyl-, (-)- |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 154.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCC2CC3CC(C)CC4C5CCC(C2C1)C34CC5 |
| Np Classifier Class | Quassinoids |
| Deep Smiles | CC=CC=O)[C@H][C@][C@H]6C[C@H]OC=O)[C@@H][C@@][C@@]6[C@@H]%10[C@@H]O)[C@@H][C@@]6OC7))C))O)))))O))O)))))))C))O |
| Heavy Atom Count | 29.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCC2CC3OC(O)CC4C5CCC(C2C1)C34CO5 |
| Classyfire Subclass | Terpene lactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 855.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 11.0 |
| Uniprot Id | n.a. |
| Iupac Name | (1R,2R,3R,6R,8S,12S,13S,14R,15R,16S,17S)-2,3,12,15,16-pentahydroxy-9,13,17-trimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-ene-4,11-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -2.4 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C20H26O9 |
| Scaffold Graph Node Bond Level | O=C1C=CC2CC3OC(=O)CC4C5CCC(C2C1)C34CO5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JBDMZGKDLMGOFR-DFEKUIMESA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8 |
| Logs | -3.627 |
| Rotatable Bond Count | 0.0 |
| Logd | -0.317 |
| Synonyms | brucein d, bruceine d |
| Esol Class | Very soluble |
| Functional Groups | CC(C)=CC(C)=O, CO, COC, COC(C)=O |
| Compound Name | Bruceine D |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 410.158 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 410.158 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 410.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 11.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -0.859997800000001 |
| Inchi | InChI=1S/C20H26O9/c1-7-4-9(21)13(23)17(2)8(7)5-10-19-6-28-18(3,14(24)11(22)12(17)19)20(19,27)15(25)16(26)29-10/h4,8,10-15,22-25,27H,5-6H2,1-3H3/t8-,10+,11+,12+,13+,14-,15-,17-,18-,19+,20+/m0/s1 |
| Smiles | CC1=CC(=O)[C@H]([C@]2([C@H]1C[C@@H]3[C@]45[C@@H]2[C@H]([C@@H]([C@@]([C@@]4([C@H](C(=O)O3)O)O)(OC5)C)O)O)C)O |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Aerva Javanica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Arnica Mollis (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Bischofia Javanica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Blumea Mollis (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Brucea Antidysenterica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Brucea Javanica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Brucea Mollis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Cassia Javanica (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Cissus Javanica (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Cnesmone Javanica (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Diospyros Mollis (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Elephantopus Mollis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Emilia Javanica (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Eria Mollis (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Ficus Mollis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Grewia Mollis (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Helianthus Mollis (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Hydrocotyle Javanica (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Ixora Javanica (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Jackiella Javanica (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Lagascea Mollis (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Lippia Javanica (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Minthostachys Mollis (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Oenanthe Javanica (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Parkia Javanica (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Pedicularis Mollis (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Picrasma Javanica (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Plectranthus Mollis (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Pulmonaria Mollis (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Quassia Indica (Plant) Rel Props:Reference:ISBN:9788172362461 - 31. Outgoing r'ship
FOUND_INto/from Rhus Javanica (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Sambucus Javanica (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Sesbania Javanica (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Sophora Mollis (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Teramnus Mollis (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Thermopsis Mollis (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Wrightia Javanica (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Wyethia Mollis (Plant) Rel Props:Reference: