methyl (1R,4aS,6S,7R,7aS)-6-[(2S,3R,4S)-4-(2,2-dimethoxyethyl)-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carbonyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
PubChem CID: 122228280
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 209.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CC1CC2CCCCC2C1)C1CCC(CC2CCCCC2)CC1 |
| Np Classifier Class | Iridoids monoterpenoids, Secoiridoid monoterpenoids |
| Deep Smiles | COCC[C@H][C@@H]C=C))[C@@H]OC=C6C=O)O[C@H]C[C@H][C@@H][C@H]5C))[C@H]O)OC=C6C=O)OC))))))))))))))))O[C@@H]O[C@H]CO))[C@H][C@@H][C@H]6O))O))O))))))))))OC |
| Heavy Atom Count | 44.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC(OC1CC2CCOCC2C1)C1CCC(OC2CCCCO2)OC1 |
| Classyfire Subclass | Terpene glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1090.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 13.0 |
| Iupac Name | methyl (1R,4aS,6S,7R,7aS)-6-[(2S,3R,4S)-4-(2,2-dimethoxyethyl)-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carbonyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -0.2 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C29H42O15 |
| Scaffold Graph Node Bond Level | O=C(OC1CC2C=COCC2C1)C1=COC(OC2CCCCO2)CC1 |
| Inchi Key | OLQSEMGEQKAMCH-UXPRVSINSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 13.0 |
| Synonyms | sylvestroside iii dimethyl acetal |
| Esol Class | Soluble |
| Functional Groups | C=CC, CO, COC(=O)C1=CO[C@@H](O)CC1, COC(=O)C1=CO[C@@H](O[C@@H](C)OC)CC1, COC(C)OC |
| Compound Name | methyl (1R,4aS,6S,7R,7aS)-6-[(2S,3R,4S)-4-(2,2-dimethoxyethyl)-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carbonyl]oxy-1-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| Exact Mass | 630.252 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 630.252 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 630.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 13.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C29H42O15/c1-6-13-14(8-20(37-3)38-4)16(11-41-28(13)44-29-24(33)23(32)22(31)19(9-30)43-29)26(35)42-18-7-15-17(25(34)39-5)10-40-27(36)21(15)12(18)2/h6,10-15,18-24,27-33,36H,1,7-9H2,2-5H3/t12-,13+,14-,15+,18-,19+,21+,22+,23-,24+,27+,28-,29-/m0/s1 |
| Smiles | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O)OC(=O)C3=CO[C@H]([C@@H]([C@@H]3CC(OC)OC)C=C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Scaevola Taccada (Plant) Rel Props:Reference:ISBN:9788185042145