Mecambrine
PubChem CID: 121336
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Mecambrine, Fugapavine, 1093-07-8, (-)-Mecambrine, (12S)-11-methylspiro[3,5-dioxa-11-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7-triene-14,4'-cyclohexa-2,5-diene]-1'-one, C09588, CHEBI:6705, DTXSID90911090, Q27107306, 3'-Methyl-2'a,3',4',5'-tetrahydro-2'H,8'H-spiro[cyclohexa-2,5-diene-1,1'-cyclopenta[ij][1,3]dioxolo[4,5-g]isoquinolin]-4-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 38.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2(CC1)CC1CCCC3CC4CCCC4C2C31 |
| Np Classifier Class | Isoquinoline alkaloids |
| Deep Smiles | O=CC=CCC=C6))C[C@H]cc5cOCOc5cc9CCN%13C |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Proaporphines |
| Scaffold Graph Node Level | OC1CCC2(CC1)CC1NCCC3CC4OCOC4C2C31 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 553.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (12S)-11-methylspiro[3,5-dioxa-11-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1(15),2(6),7-triene-14,4'-cyclohexa-2,5-diene]-1'-one |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 2.4 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H17NO3 |
| Scaffold Graph Node Bond Level | O=C1C=CC2(C=C1)CC1NCCc3cc4c(c2c31)OCO4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | NMVDXQMYKKNYFO-ZDUSSCGKSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.3888888888888889 |
| Logs | -2.103 |
| Rotatable Bond Count | 0.0 |
| Logd | 1.659 |
| Synonyms | mecambrine |
| Esol Class | Soluble |
| Functional Groups | CN(C)C, O=C1C=CCC=C1, c1cOCO1 |
| Compound Name | Mecambrine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 295.121 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 295.121 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 295.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.397463381818182 |
| Inchi | InChI=1S/C18H17NO3/c1-19-7-4-11-8-14-17(22-10-21-14)16-15(11)13(19)9-18(16)5-2-12(20)3-6-18/h2-3,5-6,8,13H,4,7,9-10H2,1H3/t13-/m0/s1 |
| Smiles | CN1CCC2=CC3=C(C4=C2[C@@H]1CC45C=CC(=O)C=C5)OCO3 |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Andrographis Herba (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Cocos Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Corydalis Bungeanae (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Crataegus Pinnatifida (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Drimia Fugax (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Ephedra Herba (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Hedyotis Diffusa (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Papaver Album (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Papaver Argemone (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Papaver Bracteatum (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Papaver Caucasicum (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Papaver Commutatum (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Papaver Dubium (Plant) Rel Props:Reference:ISBN:9788172362461 - 15. Outgoing r'ship
FOUND_INto/from Papaver Fugax (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Papaver Glaucum (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Papaver Hybrid (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Papaver Hybridum (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Papaver Nudicaule (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Papaver Orientale (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Papaver Persicum (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Papaver Pseudocanescens (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Papaver Radicatum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Papaver Rhoeas (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Papaver Tatricum (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Piptostigma Fugax (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Polypodium Aureum (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Polypodium Glycyrrhiza (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Polypodium Vulgare (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Torreya Nucifera (Plant) Rel Props:Reference: