(2E)-Piperamide-C5:1
PubChem CID: 12073743
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (2E)-Piperamide-C5:1, 117137-65-2, 4,5-Dihydropiperyline, Piperamide-C5:1 (2E), CHEBI:173943, XZTCTKKANUDQCW-QHHAFSJGSA-N, DTXSID301318972, 5-(Methylenedioxyphenyl)-2-pentenoyl pyrrolidide, (E)-5-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylpent-2-en-1-one, (2E)-5-(2H-1,3-benzodioxol-5-yl)-1-(pyrrolidin-1-yl)pent-2-en-1-one, (E)-5-(Benzo[d][1,3]dioxol-5-yl)-1-(pyrrolidin-1-yl)pent-2-en-1-one |
|---|---|
| Topological Polar Surface Area | 38.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | XZTCTKKANUDQCW-QHHAFSJGSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | Piperamide-C5:1 (2E) |
| Heavy Atom Count | 20.0 |
| Compound Name | (2E)-Piperamide-C5:1 |
| Description | Constituent of pepper fruits (Piper nigrum, Piperaceae). (2E)-Piperamide-C5:1 is found in herbs and spices and pepper (spice). |
| Exact Mass | 273.136 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 273.136 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 363.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 273.33 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (E)-5-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylpent-2-en-1-one |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C16H19NO3/c18-16(17-9-3-4-10-17)6-2-1-5-13-7-8-14-15(11-13)20-12-19-14/h2,6-8,11H,1,3-5,9-10,12H2/b6-2+ |
| Smiles | C1CCN(C1)C(=O)/C=C/CCC2=CC3=C(C=C2)OCO3 |
| Xlogp | 2.7 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C16H19NO3 |
- 1. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all